C18H22F3NO4 — CID 67459980
1-O-tert-butyl 2-O-ethyl (2R,5S)-5-(2,3,4-trifluorophenyl)pyrrolidine-1,2-dicarboxylate (PubChem CID 67459980) has the molecular formula C18H22F3NO4 and a molecular weight of 373.37 g/mol. Its IUPAC name is 1-O-tert-butyl 2-O-ethyl (2R,5S)-5-(2,3,4-trifluorophenyl)pyrrolidine-1,2-dicarboxylate.
| Compound Name | 1-O-tert-butyl 2-O-ethyl (2R,5S)-5-(2,3,4-trifluorophenyl)pyrrolidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 67459980 |
| Molecular Formula | C18H22F3NO4 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 1-O-tert-butyl 2-O-ethyl (2R,5S)-5-(2,3,4-trifluorophenyl)pyrrolidine-1,2-dicarboxylate |
| SMILES | CCOC(=O)[C@H]1CC[C@@H](c2ccc(F)c(F)c2F)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H22F3NO4/c1-5-25-16(23)13-9-8-12(22(13)17(24)26-18(2,3)4)10-6-7-11(19)15(21)14(10)20/h6-7,12-13H,5,8-9H2,1-4H3/t12-,13+/m0/s1 |
| InChIKey | STFAQWBZJUBUDC-QWHCGFSZSA-N |
| XLogP | 4.11 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|