C22H26F2N6O5S — CID 67460154
(E)-N-(diaminomethylidene)-3-[4-[4-[2-(dimethylamino)ethylcarbamoylsulfamoyl]phenoxy]-3,5-difluorophenyl]-2-methylprop-2-enamide (PubChem CID 67460154) has the molecular formula C22H26F2N6O5S and a molecular weight of 524.55 g/mol. Its IUPAC name is (E)-N-(diaminomethylidene)-3-[4-[4-[2-(dimethylamino)ethylcarbamoylsulfamoyl]phenoxy]-3,5-difluorophenyl]-2-methylprop-2-enamide.
| Compound Name | (E)-N-(diaminomethylidene)-3-[4-[4-[2-(dimethylamino)ethylcarbamoylsulfamoyl]phenoxy]-3,5-difluorophenyl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 67460154 |
| Molecular Formula | C22H26F2N6O5S |
| Molecular Weight | 524.55 g/mol |
| Exact Mass | 524.17 |
| IUPAC Name | (E)-N-(diaminomethylidene)-3-[4-[4-[2-(dimethylamino)ethylcarbamoylsulfamoyl]phenoxy]-3,5-difluorophenyl]-2-methylprop-2-enamide |
| SMILES | C/C(=C\c1cc(F)c(Oc2ccc(S(=O)(=O)NC(=O)NCCN(C)C)cc2)c(F)c1)C(=O)N=C(N)N |
| InChI | InChI=1S/C22H26F2N6O5S/c1-13(20(31)28-21(25)26)10-14-11-17(23)19(18(24)12-14)35-15-4-6-16(7-5-15)36(33,34)29-22(32)27-8-9-30(2)3/h4-7,10-12H,8-9H2,1-3H3,(H2,27,29,32)(H4,25,26,28,31)/b13-10+ |
| InChIKey | FYBGSXZVVUZEIB-JLHYYAGUSA-N |
| XLogP | 1.51 |
| TPSA | 169.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.55 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|