C30H44N6O10 — CID 67460840
tert-butyl N-[1,4-bis[4-(2,5-dioxopyrrol-1-yl)butylamino]-3-[(2-methylpropan-2-yl)oxycarbonylamino]-1,4-dioxobutan-2-yl]carbamate (PubChem CID 67460840) has the molecular formula C30H44N6O10 and a molecular weight of 648.71 g/mol. Its IUPAC name is tert-butyl N-[1,4-bis[4-(2,5-dioxopyrrol-1-yl)butylamino]-3-[(2-methylpropan-2-yl)oxycarbonylamino]-1,4-dioxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1,4-bis[4-(2,5-dioxopyrrol-1-yl)butylamino]-3-[(2-methylpropan-2-yl)oxycarbonylamino]-1,4-dioxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 67460840 |
| Molecular Formula | C30H44N6O10 |
| Molecular Weight | 648.71 g/mol |
| Exact Mass | 648.31 |
| IUPAC Name | tert-butyl N-[1,4-bis[4-(2,5-dioxopyrrol-1-yl)butylamino]-3-[(2-methylpropan-2-yl)oxycarbonylamino]-1,4-dioxobutan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(C(=O)NCCCCN1C(=O)C=CC1=O)C(NC(=O)OC(C)(C)C)C(=O)NCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C30H44N6O10/c1-29(2,3)45-27(43)33-23(25(41)31-15-7-9-17-35-19(37)11-12-20(35)38)24(34-28(44)46-30(4,5)6)26(42)32-16-8-10-18-36-21(39)13-14-22(36)40/h11-14,23-24H,7-10,15-18H2,1-6H3,(H,31,41)(H,32,42)(H,33,43)(H,34,44) |
| InChIKey | NRSDKVBOKUPNMD-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 209.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.71 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|