C19H20F3NO3 — CID 67461396
methyl (E)-3-[(2R,6S)-1-but-3-enoyl-6-(3,4,5-trifluorophenyl)piperidin-2-yl]prop-2-enoate (PubChem CID 67461396) has the molecular formula C19H20F3NO3 and a molecular weight of 367.37 g/mol. Its IUPAC name is methyl (E)-3-[(2R,6S)-1-but-3-enoyl-6-(3,4,5-trifluorophenyl)piperidin-2-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[(2R,6S)-1-but-3-enoyl-6-(3,4,5-trifluorophenyl)piperidin-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 67461396 |
| Molecular Formula | C19H20F3NO3 |
| Molecular Weight | 367.37 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | methyl (E)-3-[(2R,6S)-1-but-3-enoyl-6-(3,4,5-trifluorophenyl)piperidin-2-yl]prop-2-enoate |
| SMILES | C=CCC(=O)N1[C@@H](/C=C/C(=O)OC)CCC[C@H]1c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C19H20F3NO3/c1-3-5-17(24)23-13(8-9-18(25)26-2)6-4-7-16(23)12-10-14(20)19(22)15(21)11-12/h3,8-11,13,16H,1,4-7H2,2H3/b9-8+/t13-,16+/m1/s1 |
| InChIKey | VFUWHPIKGLYYTG-LKVBTMTGSA-N |
| XLogP | 3.83 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.37 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|