About (2R)-6-(3,4-difluorophenyl)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexanoic acid
(2R)-6-(3,4-difluorophenyl)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexanoic acid (PubChem CID 67461444) has the molecular formula C18H23F2NO5
and a molecular weight of 371.38 g/mol. Its IUPAC name is (2R)-6-(3,4-difluorophenyl)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexanoic acid.
Molecular Properties
| Compound Name | (2R)-6-(3,4-difluorophenyl)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexanoic acid |
| PubChem CID | 67461444 |
| Molecular Formula | C18H23F2NO5 |
| Molecular Weight | 371.38 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | (2R)-6-(3,4-difluorophenyl)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@](C)(CCCC(=O)c1ccc(F)c(F)c1)C(=O)O |
| InChI | InChI=1S/C18H23F2NO5/c1-17(2,3)26-16(25)21-18(4,15(23)24)9-5-6-14(22)11-7-8-12(19)13(20)10-11/h7-8,10H,5-6,9H2,1-4H3,(H,21,25)(H,23,24)/t18-/m1/s1 |
| InChIKey | YFMGIBOFSKCEQW-GOSISDBHSA-N |
| XLogP | 3.69 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-6-(3,4-difluorophenyl)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-6-(3,4-difluorophenyl)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexanoic acid?
The IUPAC name of (2R)-6-(3,4-difluorophenyl)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexanoic acid (CID 67461444) is (2R)-6-(3,4-difluorophenyl)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexanoic acid.
What is the SMILES notation for (2R)-6-(3,4-difluorophenyl)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexanoic acid?
The canonical SMILES for (2R)-6-(3,4-difluorophenyl)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexanoic acid is CC(C)(C)OC(=O)N[C@](C)(CCCC(=O)c1ccc(F)c(F)c1)C(=O)O.
What is the InChIKey of (2R)-6-(3,4-difluorophenyl)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexanoic acid?
The InChIKey is YFMGIBOFSKCEQW-GOSISDBHSA-N. The full InChI is InChI=1S/C18H23F2NO5/c1-17(2,3)26-16(25)21-18(4,15(23)24)9-5-6-14(22)11-7-8-12(19)13(20)10-11/h7-8,10H,5-6,9H2,1-4H3,(H,21,25)(H,23,24)/t18-/m1/s1.
What are the key properties of (2R)-6-(3,4-difluorophenyl)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexanoic acid?
(2R)-6-(3,4-difluorophenyl)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexanoic acid has a molecular weight of 371.38 g/mol, XLogP of 3.69, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-6-(3,4-difluorophenyl)-2-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]-6-oxohexanoic acid is sourced from PubChem (CID 67461444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).