C17H18F2N2O3 — CID 67461500
methyl (E)-3-[(2R,5S)-1-but-3-enoyl-5-(2,6-difluoro-3-pyridinyl)pyrrolidin-2-yl]prop-2-enoate (PubChem CID 67461500) has the molecular formula C17H18F2N2O3 and a molecular weight of 336.34 g/mol. Its IUPAC name is methyl (E)-3-[(2R,5S)-1-but-3-enoyl-5-(2,6-difluoro-3-pyridinyl)pyrrolidin-2-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[(2R,5S)-1-but-3-enoyl-5-(2,6-difluoro-3-pyridinyl)pyrrolidin-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 67461500 |
| Molecular Formula | C17H18F2N2O3 |
| Molecular Weight | 336.34 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | methyl (E)-3-[(2R,5S)-1-but-3-enoyl-5-(2,6-difluoro-3-pyridinyl)pyrrolidin-2-yl]prop-2-enoate |
| SMILES | C=CCC(=O)N1[C@@H](/C=C/C(=O)OC)CC[C@H]1c1ccc(F)nc1F |
| InChI | InChI=1S/C17H18F2N2O3/c1-3-4-15(22)21-11(6-10-16(23)24-2)5-8-13(21)12-7-9-14(18)20-17(12)19/h3,6-7,9-11,13H,1,4-5,8H2,2H3/b10-6+/t11-,13+/m1/s1 |
| InChIKey | AJDNJZKSXRIIBO-RSTGABKKSA-N |
| XLogP | 2.70 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|