About 6-bromo-2-chloro-[1,3]thiazolo[4,5-b]pyridine;hydrochloride
6-bromo-2-chloro-[1,3]thiazolo[4,5-b]pyridine;hydrochloride (PubChem CID 67462755) has the molecular formula C6H3BrCl2N2S
and a molecular weight of 285.98 g/mol. Its IUPAC name is 6-bromo-2-chloro-[1,3]thiazolo[4,5-b]pyridine;hydrochloride.
Molecular Properties
| Compound Name | 6-bromo-2-chloro-[1,3]thiazolo[4,5-b]pyridine;hydrochloride |
| PubChem CID | 67462755 |
| Molecular Formula | C6H3BrCl2N2S |
| Molecular Weight | 285.98 g/mol |
| Exact Mass | 283.86 |
| IUPAC Name | 6-bromo-2-chloro-[1,3]thiazolo[4,5-b]pyridine;hydrochloride |
| SMILES | Cl.Clc1nc2ncc(Br)cc2s1 |
| InChI | InChI=1S/C6H2BrClN2S.ClH/c7-3-1-4-5(9-2-3)10-6(8)11-4;/h1-2H;1H |
| InChIKey | GVCXGQHETVFCTO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.98 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-bromo-2-chloro-[1,3]thiazolo[4,5-b]pyridine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2-chloro-[1,3]thiazolo[4,5-b]pyridine;hydrochloride?
The IUPAC name of 6-bromo-2-chloro-[1,3]thiazolo[4,5-b]pyridine;hydrochloride (CID 67462755) is 6-bromo-2-chloro-[1,3]thiazolo[4,5-b]pyridine;hydrochloride.
What is the SMILES notation for 6-bromo-2-chloro-[1,3]thiazolo[4,5-b]pyridine;hydrochloride?
The canonical SMILES for 6-bromo-2-chloro-[1,3]thiazolo[4,5-b]pyridine;hydrochloride is Cl.Clc1nc2ncc(Br)cc2s1.
What is the InChIKey of 6-bromo-2-chloro-[1,3]thiazolo[4,5-b]pyridine;hydrochloride?
The InChIKey is GVCXGQHETVFCTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2BrClN2S.ClH/c7-3-1-4-5(9-2-3)10-6(8)11-4;/h1-2H;1H.
What are the key properties of 6-bromo-2-chloro-[1,3]thiazolo[4,5-b]pyridine;hydrochloride?
6-bromo-2-chloro-[1,3]thiazolo[4,5-b]pyridine;hydrochloride has a molecular weight of 285.98 g/mol, XLogP of 3.53, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2-chloro-[1,3]thiazolo[4,5-b]pyridine;hydrochloride is sourced from PubChem (CID 67462755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).