About 2-(5,5-dimethylcyclohexen-1-yl)pentan-2-ol
2-(5,5-dimethylcyclohexen-1-yl)pentan-2-ol (PubChem CID 67463749) has the molecular formula C13H24O
and a molecular weight of 196.33 g/mol. Its IUPAC name is 2-(5,5-dimethylcyclohexen-1-yl)pentan-2-ol.
Molecular Properties
| Compound Name | 2-(5,5-dimethylcyclohexen-1-yl)pentan-2-ol |
| PubChem CID | 67463749 |
| Molecular Formula | C13H24O |
| Molecular Weight | 196.33 g/mol |
| Exact Mass | 196.18 |
| IUPAC Name | 2-(5,5-dimethylcyclohexen-1-yl)pentan-2-ol |
| SMILES | CCCC(C)(O)C1=CCCC(C)(C)C1 |
| InChI | InChI=1S/C13H24O/c1-5-8-13(4,14)11-7-6-9-12(2,3)10-11/h7,14H,5-6,8-10H2,1-4H3 |
| InChIKey | FDKSDKVTPOQPPJ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.33 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(5,5-dimethylcyclohexen-1-yl)pentan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5,5-dimethylcyclohexen-1-yl)pentan-2-ol?
The IUPAC name of 2-(5,5-dimethylcyclohexen-1-yl)pentan-2-ol (CID 67463749) is 2-(5,5-dimethylcyclohexen-1-yl)pentan-2-ol.
What is the SMILES notation for 2-(5,5-dimethylcyclohexen-1-yl)pentan-2-ol?
The canonical SMILES for 2-(5,5-dimethylcyclohexen-1-yl)pentan-2-ol is CCCC(C)(O)C1=CCCC(C)(C)C1.
What is the InChIKey of 2-(5,5-dimethylcyclohexen-1-yl)pentan-2-ol?
The InChIKey is FDKSDKVTPOQPPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O/c1-5-8-13(4,14)11-7-6-9-12(2,3)10-11/h7,14H,5-6,8-10H2,1-4H3.
What are the key properties of 2-(5,5-dimethylcyclohexen-1-yl)pentan-2-ol?
2-(5,5-dimethylcyclohexen-1-yl)pentan-2-ol has a molecular weight of 196.33 g/mol, XLogP of 3.67, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5,5-dimethylcyclohexen-1-yl)pentan-2-ol is sourced from PubChem (CID 67463749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).