C19H21F2NO3 — CID 67463810
methyl (Z)-3-[(2R,6S)-1-but-3-enoyl-6-(3,4-difluorophenyl)piperidin-2-yl]prop-2-enoate (PubChem CID 67463810) has the molecular formula C19H21F2NO3 and a molecular weight of 349.38 g/mol. Its IUPAC name is methyl (Z)-3-[(2R,6S)-1-but-3-enoyl-6-(3,4-difluorophenyl)piperidin-2-yl]prop-2-enoate.
| Compound Name | methyl (Z)-3-[(2R,6S)-1-but-3-enoyl-6-(3,4-difluorophenyl)piperidin-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 67463810 |
| Molecular Formula | C19H21F2NO3 |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | methyl (Z)-3-[(2R,6S)-1-but-3-enoyl-6-(3,4-difluorophenyl)piperidin-2-yl]prop-2-enoate |
| SMILES | C=CCC(=O)N1[C@@H](/C=C\C(=O)OC)CCC[C@H]1c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C19H21F2NO3/c1-3-5-18(23)22-14(9-11-19(24)25-2)6-4-7-17(22)13-8-10-15(20)16(21)12-13/h3,8-12,14,17H,1,4-7H2,2H3/b11-9-/t14-,17+/m1/s1 |
| InChIKey | ROERDRIXMYEBSZ-IBFHOGNFSA-N |
| XLogP | 3.69 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|