C30H39N5O4 — CID 67464063
N-(5-hydroxy-2-adamantyl)-6-[(2R)-4-[4-methoxy-3-(methylcarbamoyl)phenyl]-2-methylpiperazin-1-yl]pyridine-2-carboxamide (PubChem CID 67464063) has the molecular formula C30H39N5O4 and a molecular weight of 533.67 g/mol. Its IUPAC name is N-(5-hydroxy-2-adamantyl)-6-[(2R)-4-[4-methoxy-3-(methylcarbamoyl)phenyl]-2-methylpiperazin-1-yl]pyridine-2-carboxamide.
| Compound Name | N-(5-hydroxy-2-adamantyl)-6-[(2R)-4-[4-methoxy-3-(methylcarbamoyl)phenyl]-2-methylpiperazin-1-yl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 67464063 |
| Molecular Formula | C30H39N5O4 |
| Molecular Weight | 533.67 g/mol |
| Exact Mass | 533.30 |
| IUPAC Name | N-(5-hydroxy-2-adamantyl)-6-[(2R)-4-[4-methoxy-3-(methylcarbamoyl)phenyl]-2-methylpiperazin-1-yl]pyridine-2-carboxamide |
| SMILES | CNC(=O)c1cc(N2CCN(c3cccc(C(=O)NC4C5CC6CC4CC(O)(C6)C5)n3)[C@H](C)C2)ccc1OC |
| InChI | InChI=1S/C30H39N5O4/c1-18-17-34(22-7-8-25(39-3)23(13-22)28(36)31-2)9-10-35(18)26-6-4-5-24(32-26)29(37)33-27-20-11-19-12-21(27)16-30(38,14-19)15-20/h4-8,13,18-21,27,38H,9-12,14-17H2,1-3H3,(H,31,36)(H,33,37)/t18-,19?,20?,21?,27?,30?/m1/s1 |
| InChIKey | GVNKDVSDXFGZKB-UOPDYBEISA-N |
| XLogP | 2.83 |
| TPSA | 107.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.67 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|