C14H13F2NO2 — CID 67464191
(4R)-4-(3,4-difluorophenyl)-3,4,7,8-tetrahydro-1H-pyrido[2,1-c][1,4]oxazin-6-one (PubChem CID 67464191) has the molecular formula C14H13F2NO2 and a molecular weight of 265.26 g/mol. Its IUPAC name is (4R)-4-(3,4-difluorophenyl)-3,4,7,8-tetrahydro-1H-pyrido[2,1-c][1,4]oxazin-6-one.
| Compound Name | (4R)-4-(3,4-difluorophenyl)-3,4,7,8-tetrahydro-1H-pyrido[2,1-c][1,4]oxazin-6-one |
|---|---|
| PubChem CID | 67464191 |
| Molecular Formula | C14H13F2NO2 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | (4R)-4-(3,4-difluorophenyl)-3,4,7,8-tetrahydro-1H-pyrido[2,1-c][1,4]oxazin-6-one |
| SMILES | O=C1CCC=C2COC[C@@H](c3ccc(F)c(F)c3)N12 |
| InChI | InChI=1S/C14H13F2NO2/c15-11-5-4-9(6-12(11)16)13-8-19-7-10-2-1-3-14(18)17(10)13/h2,4-6,13H,1,3,7-8H2/t13-/m0/s1 |
| InChIKey | SERSSGPCNQBUJR-ZDUSSCGKSA-N |
| XLogP | 2.54 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |