About tert-butyl 3-(diethoxymethyl)-7-fluoro-4-oxospiro[chromene-2,4'-piperidine]-3-carboxylate
tert-butyl 3-(diethoxymethyl)-7-fluoro-4-oxospiro[chromene-2,4'-piperidine]-3-carboxylate (PubChem CID 67464386) has the molecular formula C23H32FNO6
and a molecular weight of 437.51 g/mol. Its IUPAC name is tert-butyl 3-(diethoxymethyl)-7-fluoro-4-oxospiro[chromene-2,4'-piperidine]-3-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 3-(diethoxymethyl)-7-fluoro-4-oxospiro[chromene-2,4'-piperidine]-3-carboxylate |
| PubChem CID | 67464386 |
| Molecular Formula | C23H32FNO6 |
| Molecular Weight | 437.51 g/mol |
| Exact Mass | 437.22 |
| IUPAC Name | tert-butyl 3-(diethoxymethyl)-7-fluoro-4-oxospiro[chromene-2,4'-piperidine]-3-carboxylate |
| SMILES | CCOC(OCC)C1(C(=O)OC(C)(C)C)C(=O)c2ccc(F)cc2OC12CCNCC2 |
| InChI | InChI=1S/C23H32FNO6/c1-6-28-20(29-7-2)23(19(27)31-21(3,4)5)18(26)16-9-8-15(24)14-17(16)30-22(23)10-12-25-13-11-22/h8-9,14,20,25H,6-7,10-13H2,1-5H3 |
| InChIKey | OAGRDMHOCNRPOF-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.51 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 3-(diethoxymethyl)-7-fluoro-4-oxospiro[chromene-2,4'-piperidine]-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-(diethoxymethyl)-7-fluoro-4-oxospiro[chromene-2,4'-piperidine]-3-carboxylate?
The IUPAC name of tert-butyl 3-(diethoxymethyl)-7-fluoro-4-oxospiro[chromene-2,4'-piperidine]-3-carboxylate (CID 67464386) is tert-butyl 3-(diethoxymethyl)-7-fluoro-4-oxospiro[chromene-2,4'-piperidine]-3-carboxylate.
What is the SMILES notation for tert-butyl 3-(diethoxymethyl)-7-fluoro-4-oxospiro[chromene-2,4'-piperidine]-3-carboxylate?
The canonical SMILES for tert-butyl 3-(diethoxymethyl)-7-fluoro-4-oxospiro[chromene-2,4'-piperidine]-3-carboxylate is CCOC(OCC)C1(C(=O)OC(C)(C)C)C(=O)c2ccc(F)cc2OC12CCNCC2.
What is the InChIKey of tert-butyl 3-(diethoxymethyl)-7-fluoro-4-oxospiro[chromene-2,4'-piperidine]-3-carboxylate?
The InChIKey is OAGRDMHOCNRPOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H32FNO6/c1-6-28-20(29-7-2)23(19(27)31-21(3,4)5)18(26)16-9-8-15(24)14-17(16)30-22(23)10-12-25-13-11-22/h8-9,14,20,25H,6-7,10-13H2,1-5H3.
What are the key properties of tert-butyl 3-(diethoxymethyl)-7-fluoro-4-oxospiro[chromene-2,4'-piperidine]-3-carboxylate?
tert-butyl 3-(diethoxymethyl)-7-fluoro-4-oxospiro[chromene-2,4'-piperidine]-3-carboxylate has a molecular weight of 437.51 g/mol, XLogP of 3.25, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-(diethoxymethyl)-7-fluoro-4-oxospiro[chromene-2,4'-piperidine]-3-carboxylate is sourced from PubChem (CID 67464386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).