About 2-[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-5-yl)phenoxy]ethyl 3,3-dimethylbutanoate
2-[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-5-yl)phenoxy]ethyl 3,3-dimethylbutanoate (PubChem CID 67464821) has the molecular formula C24H28O7
and a molecular weight of 428.48 g/mol. Its IUPAC name is 2-[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-5-yl)phenoxy]ethyl 3,3-dimethylbutanoate.
Molecular Properties
| Compound Name | 2-[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-5-yl)phenoxy]ethyl 3,3-dimethylbutanoate |
| PubChem CID | 67464821 |
| Molecular Formula | C24H28O7 |
| Molecular Weight | 428.48 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 2-[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-5-yl)phenoxy]ethyl 3,3-dimethylbutanoate |
| SMILES | COc1ccc(-c2ccc3c(c2)COC3=O)c(OCCOC(=O)CC(C)(C)C)c1OC |
| InChI | InChI=1S/C24H28O7/c1-24(2,3)13-20(25)29-10-11-30-21-17(8-9-19(27-4)22(21)28-5)15-6-7-18-16(12-15)14-31-23(18)26/h6-9,12H,10-11,13-14H2,1-5H3 |
| InChIKey | AMWCBRYTUKJFJH-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 428.48 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-5-yl)phenoxy]ethyl 3,3-dimethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-5-yl)phenoxy]ethyl 3,3-dimethylbutanoate?
The IUPAC name of 2-[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-5-yl)phenoxy]ethyl 3,3-dimethylbutanoate (CID 67464821) is 2-[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-5-yl)phenoxy]ethyl 3,3-dimethylbutanoate.
What is the SMILES notation for 2-[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-5-yl)phenoxy]ethyl 3,3-dimethylbutanoate?
The canonical SMILES for 2-[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-5-yl)phenoxy]ethyl 3,3-dimethylbutanoate is COc1ccc(-c2ccc3c(c2)COC3=O)c(OCCOC(=O)CC(C)(C)C)c1OC.
What is the InChIKey of 2-[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-5-yl)phenoxy]ethyl 3,3-dimethylbutanoate?
The InChIKey is AMWCBRYTUKJFJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28O7/c1-24(2,3)13-20(25)29-10-11-30-21-17(8-9-19(27-4)22(21)28-5)15-6-7-18-16(12-15)14-31-23(18)26/h6-9,12H,10-11,13-14H2,1-5H3.
What are the key properties of 2-[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-5-yl)phenoxy]ethyl 3,3-dimethylbutanoate?
2-[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-5-yl)phenoxy]ethyl 3,3-dimethylbutanoate has a molecular weight of 428.48 g/mol, XLogP of 4.40, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-5-yl)phenoxy]ethyl 3,3-dimethylbutanoate is sourced from PubChem (CID 67464821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).