About 1,3-dipentyltriazol-1-ium
1,3-dipentyltriazol-1-ium (PubChem CID 67465154) has the molecular formula C12H24N3+
and a molecular weight of 210.34 g/mol. Its IUPAC name is 1,3-dipentyltriazol-1-ium.
Molecular Properties
| Compound Name | 1,3-dipentyltriazol-1-ium |
| PubChem CID | 67465154 |
| Molecular Formula | C12H24N3+ |
| Molecular Weight | 210.34 g/mol |
| Exact Mass | 210.20 |
| IUPAC Name | 1,3-dipentyltriazol-1-ium |
| SMILES | CCCCCn1cc[n+](CCCCC)n1 |
| InChI | InChI=1S/C12H24N3/c1-3-5-7-9-14-11-12-15(13-14)10-8-6-4-2/h11-12H,3-10H2,1-2H3/q+1 |
| InChIKey | DKHSOWCRQXTQAQ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.34 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dipentyltriazol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dipentyltriazol-1-ium?
The IUPAC name of 1,3-dipentyltriazol-1-ium (CID 67465154) is 1,3-dipentyltriazol-1-ium.
What is the SMILES notation for 1,3-dipentyltriazol-1-ium?
The canonical SMILES for 1,3-dipentyltriazol-1-ium is CCCCCn1cc[n+](CCCCC)n1.
What is the InChIKey of 1,3-dipentyltriazol-1-ium?
The InChIKey is DKHSOWCRQXTQAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N3/c1-3-5-7-9-14-11-12-15(13-14)10-8-6-4-2/h11-12H,3-10H2,1-2H3/q+1.
What are the key properties of 1,3-dipentyltriazol-1-ium?
1,3-dipentyltriazol-1-ium has a molecular weight of 210.34 g/mol, XLogP of 2.55, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dipentyltriazol-1-ium is sourced from PubChem (CID 67465154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).