C10H19FO3S — CID 67465198
(2S,3R,4S,5S)-3-fluoro-5-(hydroxymethyl)-2-pentylthiolane-2,4-diol (PubChem CID 67465198) has the molecular formula C10H19FO3S and a molecular weight of 238.32 g/mol. Its IUPAC name is (2S,3R,4S,5S)-3-fluoro-5-(hydroxymethyl)-2-pentylthiolane-2,4-diol.
| Compound Name | (2S,3R,4S,5S)-3-fluoro-5-(hydroxymethyl)-2-pentylthiolane-2,4-diol |
|---|---|
| PubChem CID | 67465198 |
| Molecular Formula | C10H19FO3S |
| Molecular Weight | 238.32 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | (2S,3R,4S,5S)-3-fluoro-5-(hydroxymethyl)-2-pentylthiolane-2,4-diol |
| SMILES | CCCCC[C@]1(O)S[C@@H](CO)[C@@H](O)[C@H]1F |
| InChI | InChI=1S/C10H19FO3S/c1-2-3-4-5-10(14)9(11)8(13)7(6-12)15-10/h7-9,12-14H,2-6H2,1H3/t7-,8+,9+,10-/m0/s1 |
| InChIKey | XYPJXWCVFVADKB-JLIMGVALSA-N |
| XLogP | 1.06 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.32 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|