About 3-(2-thiophen-2-yl-1,3-benzoxazol-6-yl)-1H-pyridazin-6-one
3-(2-thiophen-2-yl-1,3-benzoxazol-6-yl)-1H-pyridazin-6-one (PubChem CID 67465258) has the molecular formula C15H9N3O2S
and a molecular weight of 295.32 g/mol. Its IUPAC name is 3-(2-thiophen-2-yl-1,3-benzoxazol-6-yl)-1H-pyridazin-6-one.
Molecular Properties
| Compound Name | 3-(2-thiophen-2-yl-1,3-benzoxazol-6-yl)-1H-pyridazin-6-one |
| PubChem CID | 67465258 |
| Molecular Formula | C15H9N3O2S |
| Molecular Weight | 295.32 g/mol |
| Exact Mass | 295.04 |
| IUPAC Name | 3-(2-thiophen-2-yl-1,3-benzoxazol-6-yl)-1H-pyridazin-6-one |
| SMILES | O=c1ccc(-c2ccc3nc(-c4cccs4)oc3c2)n[nH]1 |
| InChI | InChI=1S/C15H9N3O2S/c19-14-6-5-10(17-18-14)9-3-4-11-12(8-9)20-15(16-11)13-2-1-7-21-13/h1-8H,(H,18,19) |
| InChIKey | LTRSKKCSKDXBFV-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.32 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(2-thiophen-2-yl-1,3-benzoxazol-6-yl)-1H-pyridazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-thiophen-2-yl-1,3-benzoxazol-6-yl)-1H-pyridazin-6-one?
The IUPAC name of 3-(2-thiophen-2-yl-1,3-benzoxazol-6-yl)-1H-pyridazin-6-one (CID 67465258) is 3-(2-thiophen-2-yl-1,3-benzoxazol-6-yl)-1H-pyridazin-6-one.
What is the SMILES notation for 3-(2-thiophen-2-yl-1,3-benzoxazol-6-yl)-1H-pyridazin-6-one?
The canonical SMILES for 3-(2-thiophen-2-yl-1,3-benzoxazol-6-yl)-1H-pyridazin-6-one is O=c1ccc(-c2ccc3nc(-c4cccs4)oc3c2)n[nH]1.
What is the InChIKey of 3-(2-thiophen-2-yl-1,3-benzoxazol-6-yl)-1H-pyridazin-6-one?
The InChIKey is LTRSKKCSKDXBFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H9N3O2S/c19-14-6-5-10(17-18-14)9-3-4-11-12(8-9)20-15(16-11)13-2-1-7-21-13/h1-8H,(H,18,19).
What are the key properties of 3-(2-thiophen-2-yl-1,3-benzoxazol-6-yl)-1H-pyridazin-6-one?
3-(2-thiophen-2-yl-1,3-benzoxazol-6-yl)-1H-pyridazin-6-one has a molecular weight of 295.32 g/mol, XLogP of 3.31, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-thiophen-2-yl-1,3-benzoxazol-6-yl)-1H-pyridazin-6-one is sourced from PubChem (CID 67465258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).