About [1-[[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-5-yl)phenoxy]methyl]cyclopropyl] acetate
[1-[[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-5-yl)phenoxy]methyl]cyclopropyl] acetate (PubChem CID 67465513) has the molecular formula C22H22O7
and a molecular weight of 398.41 g/mol. Its IUPAC name is [1-[[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-5-yl)phenoxy]methyl]cyclopropyl] acetate.
Molecular Properties
| Compound Name | [1-[[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-5-yl)phenoxy]methyl]cyclopropyl] acetate |
| PubChem CID | 67465513 |
| Molecular Formula | C22H22O7 |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.14 |
| IUPAC Name | [1-[[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-5-yl)phenoxy]methyl]cyclopropyl] acetate |
| SMILES | COc1ccc(-c2ccc3c(c2)COC3=O)c(OCC2(OC(C)=O)CC2)c1OC |
| InChI | InChI=1S/C22H22O7/c1-13(23)29-22(8-9-22)12-28-19-16(6-7-18(25-2)20(19)26-3)14-4-5-17-15(10-14)11-27-21(17)24/h4-7,10H,8-9,11-12H2,1-3H3 |
| InChIKey | BMAVNHMRPIIUFV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze [1-[[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-5-yl)phenoxy]methyl]cyclopropyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-5-yl)phenoxy]methyl]cyclopropyl] acetate?
The IUPAC name of [1-[[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-5-yl)phenoxy]methyl]cyclopropyl] acetate (CID 67465513) is [1-[[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-5-yl)phenoxy]methyl]cyclopropyl] acetate.
What is the SMILES notation for [1-[[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-5-yl)phenoxy]methyl]cyclopropyl] acetate?
The canonical SMILES for [1-[[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-5-yl)phenoxy]methyl]cyclopropyl] acetate is COc1ccc(-c2ccc3c(c2)COC3=O)c(OCC2(OC(C)=O)CC2)c1OC.
What is the InChIKey of [1-[[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-5-yl)phenoxy]methyl]cyclopropyl] acetate?
The InChIKey is BMAVNHMRPIIUFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22O7/c1-13(23)29-22(8-9-22)12-28-19-16(6-7-18(25-2)20(19)26-3)14-4-5-17-15(10-14)11-27-21(17)24/h4-7,10H,8-9,11-12H2,1-3H3.
What are the key properties of [1-[[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-5-yl)phenoxy]methyl]cyclopropyl] acetate?
[1-[[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-5-yl)phenoxy]methyl]cyclopropyl] acetate has a molecular weight of 398.41 g/mol, XLogP of 3.52, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[[2,3-dimethoxy-6-(1-oxo-3H-2-benzofuran-5-yl)phenoxy]methyl]cyclopropyl] acetate is sourced from PubChem (CID 67465513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).