C13H19N5O6S2 — CID 67465587
4-[(1R)-1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol;N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 67465587) has the molecular formula C13H19N5O6S2 and a molecular weight of 405.46 g/mol. Its IUPAC name is 4-[(1R)-1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol;N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 4-[(1R)-1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol;N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 67465587 |
| Molecular Formula | C13H19N5O6S2 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | 4-[(1R)-1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol;N-(5-sulfamoyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | CC(=O)Nc1nnc(S(N)(=O)=O)s1.CNC[C@H](O)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C9H13NO3.C4H6N4O3S2/c1-10-5-9(13)6-2-3-7(11)8(12)4-6;1-2(9)6-3-7-8-4(12-3)13(5,10)11/h2-4,9-13H,5H2,1H3;1H3,(H2,5,10,11)(H,6,7,9)/t9-;/m0./s1 |
| InChIKey | PERWCXILBVJDCP-FVGYRXGTSA-N |
| XLogP | -0.51 |
| TPSA | 187.76 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|