About 2'-(ethoxymethylidene)spiro[3H-chromene-2,4'-piperidine]-4-one;hydrochloride
2'-(ethoxymethylidene)spiro[3H-chromene-2,4'-piperidine]-4-one;hydrochloride (PubChem CID 67465718) has the molecular formula C16H20ClNO3
and a molecular weight of 309.79 g/mol. Its IUPAC name is 2'-(ethoxymethylidene)spiro[3H-chromene-2,4'-piperidine]-4-one;hydrochloride.
Molecular Properties
| Compound Name | 2'-(ethoxymethylidene)spiro[3H-chromene-2,4'-piperidine]-4-one;hydrochloride |
| PubChem CID | 67465718 |
| Molecular Formula | C16H20ClNO3 |
| Molecular Weight | 309.79 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 2'-(ethoxymethylidene)spiro[3H-chromene-2,4'-piperidine]-4-one;hydrochloride |
| SMILES | CCOC=C1CC2(CCN1)CC(=O)c1ccccc1O2.Cl |
| InChI | InChI=1S/C16H19NO3.ClH/c1-2-19-11-12-9-16(7-8-17-12)10-14(18)13-5-3-4-6-15(13)20-16;/h3-6,11,17H,2,7-10H2,1H3;1H |
| InChIKey | BBTVBEKSTHTSHU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.79 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 2'-(ethoxymethylidene)spiro[3H-chromene-2,4'-piperidine]-4-one;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2'-(ethoxymethylidene)spiro[3H-chromene-2,4'-piperidine]-4-one;hydrochloride?
The IUPAC name of 2'-(ethoxymethylidene)spiro[3H-chromene-2,4'-piperidine]-4-one;hydrochloride (CID 67465718) is 2'-(ethoxymethylidene)spiro[3H-chromene-2,4'-piperidine]-4-one;hydrochloride.
What is the SMILES notation for 2'-(ethoxymethylidene)spiro[3H-chromene-2,4'-piperidine]-4-one;hydrochloride?
The canonical SMILES for 2'-(ethoxymethylidene)spiro[3H-chromene-2,4'-piperidine]-4-one;hydrochloride is CCOC=C1CC2(CCN1)CC(=O)c1ccccc1O2.Cl.
What is the InChIKey of 2'-(ethoxymethylidene)spiro[3H-chromene-2,4'-piperidine]-4-one;hydrochloride?
The InChIKey is BBTVBEKSTHTSHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO3.ClH/c1-2-19-11-12-9-16(7-8-17-12)10-14(18)13-5-3-4-6-15(13)20-16;/h3-6,11,17H,2,7-10H2,1H3;1H.
What are the key properties of 2'-(ethoxymethylidene)spiro[3H-chromene-2,4'-piperidine]-4-one;hydrochloride?
2'-(ethoxymethylidene)spiro[3H-chromene-2,4'-piperidine]-4-one;hydrochloride has a molecular weight of 309.79 g/mol, XLogP of 3.07, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2'-(ethoxymethylidene)spiro[3H-chromene-2,4'-piperidine]-4-one;hydrochloride is sourced from PubChem (CID 67465718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).