C33H40Cl3N5O5 — CID 67465734
[(2S)-1-[[3-[carbamoyl(2-methylbutyl)carbamoyl]-6,8-dichloro-1,2,4,9-tetrahydrocarbazol-3-yl]amino]-3-methyl-1-oxopentan-2-yl]-[(4-chlorophenyl)methyl]carbamic acid (PubChem CID 67465734) has the molecular formula C33H40Cl3N5O5 and a molecular weight of 693.07 g/mol. Its IUPAC name is [(2S)-1-[[3-[carbamoyl(2-methylbutyl)carbamoyl]-6,8-dichloro-1,2,4,9-tetrahydrocarbazol-3-yl]amino]-3-methyl-1-oxopentan-2-yl]-[(4-chlorophenyl)methyl]carbamic acid.
| Compound Name | [(2S)-1-[[3-[carbamoyl(2-methylbutyl)carbamoyl]-6,8-dichloro-1,2,4,9-tetrahydrocarbazol-3-yl]amino]-3-methyl-1-oxopentan-2-yl]-[(4-chlorophenyl)methyl]carbamic acid |
|---|---|
| PubChem CID | 67465734 |
| Molecular Formula | C33H40Cl3N5O5 |
| Molecular Weight | 693.07 g/mol |
| Exact Mass | 691.21 |
| IUPAC Name | [(2S)-1-[[3-[carbamoyl(2-methylbutyl)carbamoyl]-6,8-dichloro-1,2,4,9-tetrahydrocarbazol-3-yl]amino]-3-methyl-1-oxopentan-2-yl]-[(4-chlorophenyl)methyl]carbamic acid |
| SMILES | CCC(C)CN(C(N)=O)C(=O)C1(NC(=O)[C@H](C(C)CC)N(Cc2ccc(Cl)cc2)C(=O)O)CCc2[nH]c3c(Cl)cc(Cl)cc3c2C1 |
| InChI | InChI=1S/C33H40Cl3N5O5/c1-5-18(3)16-41(31(37)44)30(43)33(12-11-26-24(15-33)23-13-22(35)14-25(36)27(23)38-26)39-29(42)28(19(4)6-2)40(32(45)46)17-20-7-9-21(34)10-8-20/h7-10,13-14,18-19,28,38H,5-6,11-12,15-17H2,1-4H3,(H2,37,44)(H,39,42)(H,45,46)/t18?,19?,28-,33?/m0/s1 |
| InChIKey | HGTXXIAJKWSUTK-JWHQXDGFSA-N |
| XLogP | 7.02 |
| TPSA | 148.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.07 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|