C25H36NO6PS — CID 67465799
3-[(3R,5R)-3-butyl-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl]propylphosphonic acid (PubChem CID 67465799) has the molecular formula C25H36NO6PS and a molecular weight of 509.61 g/mol. Its IUPAC name is 3-[(3R,5R)-3-butyl-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl]propylphosphonic acid.
| Compound Name | 3-[(3R,5R)-3-butyl-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl]propylphosphonic acid |
|---|---|
| PubChem CID | 67465799 |
| Molecular Formula | C25H36NO6PS |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.20 |
| IUPAC Name | 3-[(3R,5R)-3-butyl-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl]propylphosphonic acid |
| SMILES | CCCC[C@]1(CC)CS(=O)(=O)c2cc(CCCP(=O)(O)O)c(OC)cc2[C@@H](c2ccccc2)N1 |
| InChI | InChI=1S/C25H36NO6PS/c1-4-6-14-25(5-2)18-34(30,31)23-16-20(13-10-15-33(27,28)29)22(32-3)17-21(23)24(26-25)19-11-8-7-9-12-19/h7-9,11-12,16-17,24,26H,4-6,10,13-15,18H2,1-3H3,(H2,27,28,29)/t24-,25-/m1/s1 |
| InChIKey | YWGSHVRWIRHOKZ-JWQCQUIFSA-N |
| XLogP | 4.61 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|