C28H36N2O8S — CID 67465816
3-[[(3R,5R)-3-butyl-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepine-8-carbonyl]amino]pentanedioic acid (PubChem CID 67465816) has the molecular formula C28H36N2O8S and a molecular weight of 560.67 g/mol. Its IUPAC name is 3-[[(3R,5R)-3-butyl-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepine-8-carbonyl]amino]pentanedioic acid.
| Compound Name | 3-[[(3R,5R)-3-butyl-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepine-8-carbonyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 67465816 |
| Molecular Formula | C28H36N2O8S |
| Molecular Weight | 560.67 g/mol |
| Exact Mass | 560.22 |
| IUPAC Name | 3-[[(3R,5R)-3-butyl-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepine-8-carbonyl]amino]pentanedioic acid |
| SMILES | CCCC[C@]1(CC)CS(=O)(=O)c2cc(C(=O)NC(CC(=O)O)CC(=O)O)c(OC)cc2[C@@H](c2ccccc2)N1 |
| InChI | InChI=1S/C28H36N2O8S/c1-4-6-12-28(5-2)17-39(36,37)23-16-20(27(35)29-19(13-24(31)32)14-25(33)34)22(38-3)15-21(23)26(30-28)18-10-8-7-9-11-18/h7-11,15-16,19,26,30H,4-6,12-14,17H2,1-3H3,(H,29,35)(H,31,32)(H,33,34)/t26-,28-/m1/s1 |
| InChIKey | JZUYZUVJGTTXPA-IXCJQBJRSA-N |
| XLogP | 3.55 |
| TPSA | 159.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.67 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |