About 2-[3-amino-2,2-difluoro-3-(2-fluorophenyl)pentoxy]acetonitrile
2-[3-amino-2,2-difluoro-3-(2-fluorophenyl)pentoxy]acetonitrile (PubChem CID 67465846) has the molecular formula C13H15F3N2O
and a molecular weight of 272.27 g/mol. Its IUPAC name is 2-[3-amino-2,2-difluoro-3-(2-fluorophenyl)pentoxy]acetonitrile.
Molecular Properties
| Compound Name | 2-[3-amino-2,2-difluoro-3-(2-fluorophenyl)pentoxy]acetonitrile |
| PubChem CID | 67465846 |
| Molecular Formula | C13H15F3N2O |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 2-[3-amino-2,2-difluoro-3-(2-fluorophenyl)pentoxy]acetonitrile |
| SMILES | CCC(N)(c1ccccc1F)C(F)(F)COCC#N |
| InChI | InChI=1S/C13H15F3N2O/c1-2-12(18,10-5-3-4-6-11(10)14)13(15,16)9-19-8-7-17/h3-6H,2,8-9,18H2,1H3 |
| InChIKey | RCPZMOHJHRBXFP-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 59.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-amino-2,2-difluoro-3-(2-fluorophenyl)pentoxy]acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-amino-2,2-difluoro-3-(2-fluorophenyl)pentoxy]acetonitrile?
The IUPAC name of 2-[3-amino-2,2-difluoro-3-(2-fluorophenyl)pentoxy]acetonitrile (CID 67465846) is 2-[3-amino-2,2-difluoro-3-(2-fluorophenyl)pentoxy]acetonitrile.
What is the SMILES notation for 2-[3-amino-2,2-difluoro-3-(2-fluorophenyl)pentoxy]acetonitrile?
The canonical SMILES for 2-[3-amino-2,2-difluoro-3-(2-fluorophenyl)pentoxy]acetonitrile is CCC(N)(c1ccccc1F)C(F)(F)COCC#N.
What is the InChIKey of 2-[3-amino-2,2-difluoro-3-(2-fluorophenyl)pentoxy]acetonitrile?
The InChIKey is RCPZMOHJHRBXFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15F3N2O/c1-2-12(18,10-5-3-4-6-11(10)14)13(15,16)9-19-8-7-17/h3-6H,2,8-9,18H2,1H3.
What are the key properties of 2-[3-amino-2,2-difluoro-3-(2-fluorophenyl)pentoxy]acetonitrile?
2-[3-amino-2,2-difluoro-3-(2-fluorophenyl)pentoxy]acetonitrile has a molecular weight of 272.27 g/mol, XLogP of 2.57, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-amino-2,2-difluoro-3-(2-fluorophenyl)pentoxy]acetonitrile is sourced from PubChem (CID 67465846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).