C27H38N2O6S — CID 67465879
(2S,3R)-2-[[(3R,5R)-3-butyl-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl]methylamino]-3-hydroxybutanoic acid (PubChem CID 67465879) has the molecular formula C27H38N2O6S and a molecular weight of 518.68 g/mol. Its IUPAC name is (2S,3R)-2-[[(3R,5R)-3-butyl-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl]methylamino]-3-hydroxybutanoic acid.
| Compound Name | (2S,3R)-2-[[(3R,5R)-3-butyl-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl]methylamino]-3-hydroxybutanoic acid |
|---|---|
| PubChem CID | 67465879 |
| Molecular Formula | C27H38N2O6S |
| Molecular Weight | 518.68 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | (2S,3R)-2-[[(3R,5R)-3-butyl-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl]methylamino]-3-hydroxybutanoic acid |
| SMILES | CCCC[C@]1(CC)CS(=O)(=O)c2cc(CN[C@H](C(=O)O)[C@@H](C)O)c(OC)cc2[C@@H](c2ccccc2)N1 |
| InChI | InChI=1S/C27H38N2O6S/c1-5-7-13-27(6-2)17-36(33,34)23-14-20(16-28-24(18(3)30)26(31)32)22(35-4)15-21(23)25(29-27)19-11-9-8-10-12-19/h8-12,14-15,18,24-25,28-30H,5-7,13,16-17H2,1-4H3,(H,31,32)/t18-,24+,25-,27-/m1/s1 |
| InChIKey | OVWKWEYMUOUHFR-RSYUDSDASA-N |
| XLogP | 3.42 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.68 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |