C24H34Cl2N7O2P — CID 67465949
N,3-bis(2-chloroethyl)-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine;2-[3-(2-cyanopropan-2-yl)-5-(1,2,4-triazol-1-ylmethyl)phenyl]-2-methylpropanenitrile (PubChem CID 67465949) has the molecular formula C24H34Cl2N7O2P and a molecular weight of 554.46 g/mol. Its IUPAC name is N,3-bis(2-chloroethyl)-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine;2-[3-(2-cyanopropan-2-yl)-5-(1,2,4-triazol-1-ylmethyl)phenyl]-2-methylpropanenitrile.
| Compound Name | N,3-bis(2-chloroethyl)-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine;2-[3-(2-cyanopropan-2-yl)-5-(1,2,4-triazol-1-ylmethyl)phenyl]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 67465949 |
| Molecular Formula | C24H34Cl2N7O2P |
| Molecular Weight | 554.46 g/mol |
| Exact Mass | 553.19 |
| IUPAC Name | N,3-bis(2-chloroethyl)-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine;2-[3-(2-cyanopropan-2-yl)-5-(1,2,4-triazol-1-ylmethyl)phenyl]-2-methylpropanenitrile |
| SMILES | CC(C)(C#N)c1cc(Cn2cncn2)cc(C(C)(C)C#N)c1.O=P1(NCCCl)OCCCN1CCCl |
| InChI | InChI=1S/C17H19N5.C7H15Cl2N2O2P/c1-16(2,9-18)14-5-13(8-22-12-20-11-21-22)6-15(7-14)17(3,4)10-19;8-2-4-10-14(12)11(6-3-9)5-1-7-13-14/h5-7,11-12H,8H2,1-4H3;1-7H2,(H,10,12) |
| InChIKey | FVBYJDJGUFJNSC-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 119.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.46 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|