C28H38N2O5S — CID 67465998
(2R)-1-[[(3R,5R)-3-butyl-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl]methyl]pyrrolidine-2-carboxylic acid (PubChem CID 67465998) has the molecular formula C28H38N2O5S and a molecular weight of 514.69 g/mol. Its IUPAC name is (2R)-1-[[(3R,5R)-3-butyl-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl]methyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-[[(3R,5R)-3-butyl-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl]methyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 67465998 |
| Molecular Formula | C28H38N2O5S |
| Molecular Weight | 514.69 g/mol |
| Exact Mass | 514.25 |
| IUPAC Name | (2R)-1-[[(3R,5R)-3-butyl-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl]methyl]pyrrolidine-2-carboxylic acid |
| SMILES | CCCC[C@]1(CC)CS(=O)(=O)c2cc(CN3CCC[C@@H]3C(=O)O)c(OC)cc2[C@@H](c2ccccc2)N1 |
| InChI | InChI=1S/C28H38N2O5S/c1-4-6-14-28(5-2)19-36(33,34)25-16-21(18-30-15-10-13-23(30)27(31)32)24(35-3)17-22(25)26(29-28)20-11-8-7-9-12-20/h7-9,11-12,16-17,23,26,29H,4-6,10,13-15,18-19H2,1-3H3,(H,31,32)/t23-,26-,28-/m1/s1 |
| InChIKey | PONARRZYCQPRIZ-KODFZCBSSA-N |
| XLogP | 4.55 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.69 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |