About 4-(3-chloro-1,2-dihydropyridin-2-yl)piperidin-4-ol;hydrochloride
4-(3-chloro-1,2-dihydropyridin-2-yl)piperidin-4-ol;hydrochloride (PubChem CID 67466094) has the molecular formula C10H16Cl2N2O
and a molecular weight of 251.16 g/mol. Its IUPAC name is 4-(3-chloro-1,2-dihydropyridin-2-yl)piperidin-4-ol;hydrochloride.
Molecular Properties
| Compound Name | 4-(3-chloro-1,2-dihydropyridin-2-yl)piperidin-4-ol;hydrochloride |
| PubChem CID | 67466094 |
| Molecular Formula | C10H16Cl2N2O |
| Molecular Weight | 251.16 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 4-(3-chloro-1,2-dihydropyridin-2-yl)piperidin-4-ol;hydrochloride |
| SMILES | Cl.OC1(C2NC=CC=C2Cl)CCNCC1 |
| InChI | InChI=1S/C10H15ClN2O.ClH/c11-8-2-1-5-13-9(8)10(14)3-6-12-7-4-10;/h1-2,5,9,12-14H,3-4,6-7H2;1H |
| InChIKey | WBIXIFBVTVWREP-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.16 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(3-chloro-1,2-dihydropyridin-2-yl)piperidin-4-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-chloro-1,2-dihydropyridin-2-yl)piperidin-4-ol;hydrochloride?
The IUPAC name of 4-(3-chloro-1,2-dihydropyridin-2-yl)piperidin-4-ol;hydrochloride (CID 67466094) is 4-(3-chloro-1,2-dihydropyridin-2-yl)piperidin-4-ol;hydrochloride.
What is the SMILES notation for 4-(3-chloro-1,2-dihydropyridin-2-yl)piperidin-4-ol;hydrochloride?
The canonical SMILES for 4-(3-chloro-1,2-dihydropyridin-2-yl)piperidin-4-ol;hydrochloride is Cl.OC1(C2NC=CC=C2Cl)CCNCC1.
What is the InChIKey of 4-(3-chloro-1,2-dihydropyridin-2-yl)piperidin-4-ol;hydrochloride?
The InChIKey is WBIXIFBVTVWREP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15ClN2O.ClH/c11-8-2-1-5-13-9(8)10(14)3-6-12-7-4-10;/h1-2,5,9,12-14H,3-4,6-7H2;1H.
What are the key properties of 4-(3-chloro-1,2-dihydropyridin-2-yl)piperidin-4-ol;hydrochloride?
4-(3-chloro-1,2-dihydropyridin-2-yl)piperidin-4-ol;hydrochloride has a molecular weight of 251.16 g/mol, XLogP of 1.13, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-chloro-1,2-dihydropyridin-2-yl)piperidin-4-ol;hydrochloride is sourced from PubChem (CID 67466094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).