About 1-methyl-7-(2-pyrrolidin-1-ylethyl)-10H-phenothiazine;trihydroiodide
1-methyl-7-(2-pyrrolidin-1-ylethyl)-10H-phenothiazine;trihydroiodide (PubChem CID 67466100) has the molecular formula C19H25I3N2S
and a molecular weight of 694.20 g/mol. Its IUPAC name is 1-methyl-7-(2-pyrrolidin-1-ylethyl)-10H-phenothiazine;trihydroiodide.
Molecular Properties
| Compound Name | 1-methyl-7-(2-pyrrolidin-1-ylethyl)-10H-phenothiazine;trihydroiodide |
| PubChem CID | 67466100 |
| Molecular Formula | C19H25I3N2S |
| Molecular Weight | 694.20 g/mol |
| Exact Mass | 693.89 |
| IUPAC Name | 1-methyl-7-(2-pyrrolidin-1-ylethyl)-10H-phenothiazine;trihydroiodide |
| SMILES | Cc1cccc2c1Nc1ccc(CCN3CCCC3)cc1S2.I.I.I |
| InChI | InChI=1S/C19H22N2S.3HI/c1-14-5-4-6-17-19(14)20-16-8-7-15(13-18(16)22-17)9-12-21-10-2-3-11-21;;;/h4-8,13,20H,2-3,9-12H2,1H3;3*1H |
| InChIKey | VXTQMVQSHPJBBU-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 694.20 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-7-(2-pyrrolidin-1-ylethyl)-10H-phenothiazine;trihydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-7-(2-pyrrolidin-1-ylethyl)-10H-phenothiazine;trihydroiodide?
The IUPAC name of 1-methyl-7-(2-pyrrolidin-1-ylethyl)-10H-phenothiazine;trihydroiodide (CID 67466100) is 1-methyl-7-(2-pyrrolidin-1-ylethyl)-10H-phenothiazine;trihydroiodide.
What is the SMILES notation for 1-methyl-7-(2-pyrrolidin-1-ylethyl)-10H-phenothiazine;trihydroiodide?
The canonical SMILES for 1-methyl-7-(2-pyrrolidin-1-ylethyl)-10H-phenothiazine;trihydroiodide is Cc1cccc2c1Nc1ccc(CCN3CCCC3)cc1S2.I.I.I.
What is the InChIKey of 1-methyl-7-(2-pyrrolidin-1-ylethyl)-10H-phenothiazine;trihydroiodide?
The InChIKey is VXTQMVQSHPJBBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22N2S.3HI/c1-14-5-4-6-17-19(14)20-16-8-7-15(13-18(16)22-17)9-12-21-10-2-3-11-21;;;/h4-8,13,20H,2-3,9-12H2,1H3;3*1H.
What are the key properties of 1-methyl-7-(2-pyrrolidin-1-ylethyl)-10H-phenothiazine;trihydroiodide?
1-methyl-7-(2-pyrrolidin-1-ylethyl)-10H-phenothiazine;trihydroiodide has a molecular weight of 694.20 g/mol, XLogP of 6.70, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-7-(2-pyrrolidin-1-ylethyl)-10H-phenothiazine;trihydroiodide is sourced from PubChem (CID 67466100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).