About 4-methyl-3-[2-(4-methylimidazol-1-yl)-1,3-benzoxazol-6-yl]-4,5-dihydro-1H-pyridazin-6-one
4-methyl-3-[2-(4-methylimidazol-1-yl)-1,3-benzoxazol-6-yl]-4,5-dihydro-1H-pyridazin-6-one (PubChem CID 67466258) has the molecular formula C16H15N5O2
and a molecular weight of 309.33 g/mol. Its IUPAC name is 4-methyl-3-[2-(4-methylimidazol-1-yl)-1,3-benzoxazol-6-yl]-4,5-dihydro-1H-pyridazin-6-one.
Molecular Properties
| Compound Name | 4-methyl-3-[2-(4-methylimidazol-1-yl)-1,3-benzoxazol-6-yl]-4,5-dihydro-1H-pyridazin-6-one |
| PubChem CID | 67466258 |
| Molecular Formula | C16H15N5O2 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 4-methyl-3-[2-(4-methylimidazol-1-yl)-1,3-benzoxazol-6-yl]-4,5-dihydro-1H-pyridazin-6-one |
| SMILES | Cc1cn(-c2nc3ccc(C4=NNC(=O)CC4C)cc3o2)cn1 |
| InChI | InChI=1S/C16H15N5O2/c1-9-5-14(22)19-20-15(9)11-3-4-12-13(6-11)23-16(18-12)21-7-10(2)17-8-21/h3-4,6-9H,5H2,1-2H3,(H,19,22) |
| InChIKey | FLXOYHPHHSLXTD-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 85.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-methyl-3-[2-(4-methylimidazol-1-yl)-1,3-benzoxazol-6-yl]-4,5-dihydro-1H-pyridazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3-[2-(4-methylimidazol-1-yl)-1,3-benzoxazol-6-yl]-4,5-dihydro-1H-pyridazin-6-one?
The IUPAC name of 4-methyl-3-[2-(4-methylimidazol-1-yl)-1,3-benzoxazol-6-yl]-4,5-dihydro-1H-pyridazin-6-one (CID 67466258) is 4-methyl-3-[2-(4-methylimidazol-1-yl)-1,3-benzoxazol-6-yl]-4,5-dihydro-1H-pyridazin-6-one.
What is the SMILES notation for 4-methyl-3-[2-(4-methylimidazol-1-yl)-1,3-benzoxazol-6-yl]-4,5-dihydro-1H-pyridazin-6-one?
The canonical SMILES for 4-methyl-3-[2-(4-methylimidazol-1-yl)-1,3-benzoxazol-6-yl]-4,5-dihydro-1H-pyridazin-6-one is Cc1cn(-c2nc3ccc(C4=NNC(=O)CC4C)cc3o2)cn1.
What is the InChIKey of 4-methyl-3-[2-(4-methylimidazol-1-yl)-1,3-benzoxazol-6-yl]-4,5-dihydro-1H-pyridazin-6-one?
The InChIKey is FLXOYHPHHSLXTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N5O2/c1-9-5-14(22)19-20-15(9)11-3-4-12-13(6-11)23-16(18-12)21-7-10(2)17-8-21/h3-4,6-9H,5H2,1-2H3,(H,19,22).
What are the key properties of 4-methyl-3-[2-(4-methylimidazol-1-yl)-1,3-benzoxazol-6-yl]-4,5-dihydro-1H-pyridazin-6-one?
4-methyl-3-[2-(4-methylimidazol-1-yl)-1,3-benzoxazol-6-yl]-4,5-dihydro-1H-pyridazin-6-one has a molecular weight of 309.33 g/mol, XLogP of 2.18, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3-[2-(4-methylimidazol-1-yl)-1,3-benzoxazol-6-yl]-4,5-dihydro-1H-pyridazin-6-one is sourced from PubChem (CID 67466258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).