C19H21F2N4O7PS — CID 67466513
2-[[4-[4-[(E)-3-(diaminomethylideneamino)-2-methyl-3-oxoprop-1-enyl]-2,6-difluorophenoxy]phenyl]sulfonylamino]ethylphosphonic acid (PubChem CID 67466513) has the molecular formula C19H21F2N4O7PS and a molecular weight of 518.44 g/mol. Its IUPAC name is 2-[[4-[4-[(E)-3-(diaminomethylideneamino)-2-methyl-3-oxoprop-1-enyl]-2,6-difluorophenoxy]phenyl]sulfonylamino]ethylphosphonic acid.
| Compound Name | 2-[[4-[4-[(E)-3-(diaminomethylideneamino)-2-methyl-3-oxoprop-1-enyl]-2,6-difluorophenoxy]phenyl]sulfonylamino]ethylphosphonic acid |
|---|---|
| PubChem CID | 67466513 |
| Molecular Formula | C19H21F2N4O7PS |
| Molecular Weight | 518.44 g/mol |
| Exact Mass | 518.08 |
| IUPAC Name | 2-[[4-[4-[(E)-3-(diaminomethylideneamino)-2-methyl-3-oxoprop-1-enyl]-2,6-difluorophenoxy]phenyl]sulfonylamino]ethylphosphonic acid |
| SMILES | C/C(=C\c1cc(F)c(Oc2ccc(S(=O)(=O)NCCP(=O)(O)O)cc2)c(F)c1)C(=O)N=C(N)N |
| InChI | InChI=1S/C19H21F2N4O7PS/c1-11(18(26)25-19(22)23)8-12-9-15(20)17(16(21)10-12)32-13-2-4-14(5-3-13)34(30,31)24-6-7-33(27,28)29/h2-5,8-10,24H,6-7H2,1H3,(H2,27,28,29)(H4,22,23,25,26)/b11-8+ |
| InChIKey | HMZXERUDMUQPNK-DHZHZOJOSA-N |
| XLogP | 1.42 |
| TPSA | 194.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.44 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|