About tert-butyl 3,7-dibromo-1-(2H-tetrazol-5-yl)phenothiazine-10-carboxylate
tert-butyl 3,7-dibromo-1-(2H-tetrazol-5-yl)phenothiazine-10-carboxylate (PubChem CID 67468173) has the molecular formula C18H15Br2N5O2S
and a molecular weight of 525.23 g/mol. Its IUPAC name is tert-butyl 3,7-dibromo-1-(2H-tetrazol-5-yl)phenothiazine-10-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 3,7-dibromo-1-(2H-tetrazol-5-yl)phenothiazine-10-carboxylate |
| PubChem CID | 67468173 |
| Molecular Formula | C18H15Br2N5O2S |
| Molecular Weight | 525.23 g/mol |
| Exact Mass | 522.93 |
| IUPAC Name | tert-butyl 3,7-dibromo-1-(2H-tetrazol-5-yl)phenothiazine-10-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1c2ccc(Br)cc2Sc2cc(Br)cc(-c3nn[nH]n3)c21 |
| InChI | InChI=1S/C18H15Br2N5O2S/c1-18(2,3)27-17(26)25-12-5-4-9(19)7-13(12)28-14-8-10(20)6-11(15(14)25)16-21-23-24-22-16/h4-8H,1-3H3,(H,21,22,23,24) |
| InChIKey | HMBLNNICUQKLLC-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 84.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 525.23 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze tert-butyl 3,7-dibromo-1-(2H-tetrazol-5-yl)phenothiazine-10-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3,7-dibromo-1-(2H-tetrazol-5-yl)phenothiazine-10-carboxylate?
The IUPAC name of tert-butyl 3,7-dibromo-1-(2H-tetrazol-5-yl)phenothiazine-10-carboxylate (CID 67468173) is tert-butyl 3,7-dibromo-1-(2H-tetrazol-5-yl)phenothiazine-10-carboxylate.
What is the SMILES notation for tert-butyl 3,7-dibromo-1-(2H-tetrazol-5-yl)phenothiazine-10-carboxylate?
The canonical SMILES for tert-butyl 3,7-dibromo-1-(2H-tetrazol-5-yl)phenothiazine-10-carboxylate is CC(C)(C)OC(=O)N1c2ccc(Br)cc2Sc2cc(Br)cc(-c3nn[nH]n3)c21.
What is the InChIKey of tert-butyl 3,7-dibromo-1-(2H-tetrazol-5-yl)phenothiazine-10-carboxylate?
The InChIKey is HMBLNNICUQKLLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15Br2N5O2S/c1-18(2,3)27-17(26)25-12-5-4-9(19)7-13(12)28-14-8-10(20)6-11(15(14)25)16-21-23-24-22-16/h4-8H,1-3H3,(H,21,22,23,24).
What are the key properties of tert-butyl 3,7-dibromo-1-(2H-tetrazol-5-yl)phenothiazine-10-carboxylate?
tert-butyl 3,7-dibromo-1-(2H-tetrazol-5-yl)phenothiazine-10-carboxylate has a molecular weight of 525.23 g/mol, XLogP of 5.93, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3,7-dibromo-1-(2H-tetrazol-5-yl)phenothiazine-10-carboxylate is sourced from PubChem (CID 67468173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).