About 4-cyclohexyl-1,3-bis[2,6-di(propan-2-yl)phenyl]triazol-1-ium
4-cyclohexyl-1,3-bis[2,6-di(propan-2-yl)phenyl]triazol-1-ium (PubChem CID 67468327) has the molecular formula C32H46N3+
and a molecular weight of 472.74 g/mol. Its IUPAC name is 4-cyclohexyl-1,3-bis[2,6-di(propan-2-yl)phenyl]triazol-1-ium.
Molecular Properties
| Compound Name | 4-cyclohexyl-1,3-bis[2,6-di(propan-2-yl)phenyl]triazol-1-ium |
| PubChem CID | 67468327 |
| Molecular Formula | C32H46N3+ |
| Molecular Weight | 472.74 g/mol |
| Exact Mass | 472.37 |
| IUPAC Name | 4-cyclohexyl-1,3-bis[2,6-di(propan-2-yl)phenyl]triazol-1-ium |
| SMILES | CC(C)c1cccc(C(C)C)c1-n1n[n+](-c2c(C(C)C)cccc2C(C)C)cc1C1CCCCC1 |
| InChI | InChI=1S/C32H46N3/c1-21(2)26-16-12-17-27(22(3)4)31(26)34-20-30(25-14-10-9-11-15-25)35(33-34)32-28(23(5)6)18-13-19-29(32)24(7)8/h12-13,16-25H,9-11,14-15H2,1-8H3/q+1 |
| InChIKey | JHMLBVZAUBZLBF-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 472.74 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclohexyl-1,3-bis[2,6-di(propan-2-yl)phenyl]triazol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclohexyl-1,3-bis[2,6-di(propan-2-yl)phenyl]triazol-1-ium?
The IUPAC name of 4-cyclohexyl-1,3-bis[2,6-di(propan-2-yl)phenyl]triazol-1-ium (CID 67468327) is 4-cyclohexyl-1,3-bis[2,6-di(propan-2-yl)phenyl]triazol-1-ium.
What is the SMILES notation for 4-cyclohexyl-1,3-bis[2,6-di(propan-2-yl)phenyl]triazol-1-ium?
The canonical SMILES for 4-cyclohexyl-1,3-bis[2,6-di(propan-2-yl)phenyl]triazol-1-ium is CC(C)c1cccc(C(C)C)c1-n1n[n+](-c2c(C(C)C)cccc2C(C)C)cc1C1CCCCC1.
What is the InChIKey of 4-cyclohexyl-1,3-bis[2,6-di(propan-2-yl)phenyl]triazol-1-ium?
The InChIKey is JHMLBVZAUBZLBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H46N3/c1-21(2)26-16-12-17-27(22(3)4)31(26)34-20-30(25-14-10-9-11-15-25)35(33-34)32-28(23(5)6)18-13-19-29(32)24(7)8/h12-13,16-25H,9-11,14-15H2,1-8H3/q+1.
What are the key properties of 4-cyclohexyl-1,3-bis[2,6-di(propan-2-yl)phenyl]triazol-1-ium?
4-cyclohexyl-1,3-bis[2,6-di(propan-2-yl)phenyl]triazol-1-ium has a molecular weight of 472.74 g/mol, XLogP of 8.69, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclohexyl-1,3-bis[2,6-di(propan-2-yl)phenyl]triazol-1-ium is sourced from PubChem (CID 67468327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).