C26H34N2O3S — CID 67468335
4-(3-butyl-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl)butanenitrile (PubChem CID 67468335) has the molecular formula C26H34N2O3S and a molecular weight of 454.64 g/mol. Its IUPAC name is 4-(3-butyl-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl)butanenitrile.
| Compound Name | 4-(3-butyl-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl)butanenitrile |
|---|---|
| PubChem CID | 67468335 |
| Molecular Formula | C26H34N2O3S |
| Molecular Weight | 454.64 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | 4-(3-butyl-3-ethyl-7-methoxy-1,1-dioxo-5-phenyl-4,5-dihydro-2H-1λ6,4-benzothiazepin-8-yl)butanenitrile |
| SMILES | CCCCC1(CC)CS(=O)(=O)c2cc(CCCC#N)c(OC)cc2C(c2ccccc2)N1 |
| InChI | InChI=1S/C26H34N2O3S/c1-4-6-15-26(5-2)19-32(29,30)24-17-21(14-10-11-16-27)23(31-3)18-22(24)25(28-26)20-12-8-7-9-13-20/h7-9,12-13,17-18,25,28H,4-6,10-11,14-15,19H2,1-3H3 |
| InChIKey | GJMOBPIECJPGKF-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.64 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|