C29H56O3 — CID 67468434
1-(4,5-dimethoxy-2-methylcyclohexyl)-3,7,11,15-tetramethylhexadec-6-en-3-ol (PubChem CID 67468434) has the molecular formula C29H56O3 and a molecular weight of 452.76 g/mol. Its IUPAC name is 1-(4,5-dimethoxy-2-methylcyclohexyl)-3,7,11,15-tetramethylhexadec-6-en-3-ol.
| Compound Name | 1-(4,5-dimethoxy-2-methylcyclohexyl)-3,7,11,15-tetramethylhexadec-6-en-3-ol |
|---|---|
| PubChem CID | 67468434 |
| Molecular Formula | C29H56O3 |
| Molecular Weight | 452.76 g/mol |
| Exact Mass | 452.42 |
| IUPAC Name | 1-(4,5-dimethoxy-2-methylcyclohexyl)-3,7,11,15-tetramethylhexadec-6-en-3-ol |
| SMILES | COC1CC(C)C(CCC(C)(O)CCC=C(C)CCCC(C)CCCC(C)C)CC1OC |
| InChI | InChI=1S/C29H56O3/c1-22(2)12-9-13-23(3)14-10-15-24(4)16-11-18-29(6,30)19-17-26-21-28(32-8)27(31-7)20-25(26)5/h16,22-23,25-28,30H,9-15,17-21H2,1-8H3 |
| InChIKey | AFBWMMRUSLZNEW-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.76 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|