About [3-(3-aminophenyl)-1-(4-fluorophenyl)propyl] N-tert-butylcarbamate
[3-(3-aminophenyl)-1-(4-fluorophenyl)propyl] N-tert-butylcarbamate (PubChem CID 67468961) has the molecular formula C20H25FN2O2
and a molecular weight of 344.43 g/mol. Its IUPAC name is [3-(3-aminophenyl)-1-(4-fluorophenyl)propyl] N-tert-butylcarbamate.
Molecular Properties
| Compound Name | [3-(3-aminophenyl)-1-(4-fluorophenyl)propyl] N-tert-butylcarbamate |
| PubChem CID | 67468961 |
| Molecular Formula | C20H25FN2O2 |
| Molecular Weight | 344.43 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | [3-(3-aminophenyl)-1-(4-fluorophenyl)propyl] N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OC(CCc1cccc(N)c1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H25FN2O2/c1-20(2,3)23-19(24)25-18(15-8-10-16(21)11-9-15)12-7-14-5-4-6-17(22)13-14/h4-6,8-11,13,18H,7,12,22H2,1-3H3,(H,23,24) |
| InChIKey | DJLBDAQVAPSYOD-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.43 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze [3-(3-aminophenyl)-1-(4-fluorophenyl)propyl] N-tert-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(3-aminophenyl)-1-(4-fluorophenyl)propyl] N-tert-butylcarbamate?
The IUPAC name of [3-(3-aminophenyl)-1-(4-fluorophenyl)propyl] N-tert-butylcarbamate (CID 67468961) is [3-(3-aminophenyl)-1-(4-fluorophenyl)propyl] N-tert-butylcarbamate.
What is the SMILES notation for [3-(3-aminophenyl)-1-(4-fluorophenyl)propyl] N-tert-butylcarbamate?
The canonical SMILES for [3-(3-aminophenyl)-1-(4-fluorophenyl)propyl] N-tert-butylcarbamate is CC(C)(C)NC(=O)OC(CCc1cccc(N)c1)c1ccc(F)cc1.
What is the InChIKey of [3-(3-aminophenyl)-1-(4-fluorophenyl)propyl] N-tert-butylcarbamate?
The InChIKey is DJLBDAQVAPSYOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25FN2O2/c1-20(2,3)23-19(24)25-18(15-8-10-16(21)11-9-15)12-7-14-5-4-6-17(22)13-14/h4-6,8-11,13,18H,7,12,22H2,1-3H3,(H,23,24).
What are the key properties of [3-(3-aminophenyl)-1-(4-fluorophenyl)propyl] N-tert-butylcarbamate?
[3-(3-aminophenyl)-1-(4-fluorophenyl)propyl] N-tert-butylcarbamate has a molecular weight of 344.43 g/mol, XLogP of 4.61, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(3-aminophenyl)-1-(4-fluorophenyl)propyl] N-tert-butylcarbamate is sourced from PubChem (CID 67468961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).