About 6-chloro-2-(oxan-4-yl)-3,4-dihydroisoquinolin-1-one
6-chloro-2-(oxan-4-yl)-3,4-dihydroisoquinolin-1-one (PubChem CID 67468989) has the molecular formula C14H16ClNO2
and a molecular weight of 265.74 g/mol. Its IUPAC name is 6-chloro-2-(oxan-4-yl)-3,4-dihydroisoquinolin-1-one.
Molecular Properties
| Compound Name | 6-chloro-2-(oxan-4-yl)-3,4-dihydroisoquinolin-1-one |
| PubChem CID | 67468989 |
| Molecular Formula | C14H16ClNO2 |
| Molecular Weight | 265.74 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | 6-chloro-2-(oxan-4-yl)-3,4-dihydroisoquinolin-1-one |
| SMILES | O=C1c2ccc(Cl)cc2CCN1C1CCOCC1 |
| InChI | InChI=1S/C14H16ClNO2/c15-11-1-2-13-10(9-11)3-6-16(14(13)17)12-4-7-18-8-5-12/h1-2,9,12H,3-8H2 |
| InChIKey | WVIZOTOMTPOGLO-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.74 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-chloro-2-(oxan-4-yl)-3,4-dihydroisoquinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2-(oxan-4-yl)-3,4-dihydroisoquinolin-1-one?
The IUPAC name of 6-chloro-2-(oxan-4-yl)-3,4-dihydroisoquinolin-1-one (CID 67468989) is 6-chloro-2-(oxan-4-yl)-3,4-dihydroisoquinolin-1-one.
What is the SMILES notation for 6-chloro-2-(oxan-4-yl)-3,4-dihydroisoquinolin-1-one?
The canonical SMILES for 6-chloro-2-(oxan-4-yl)-3,4-dihydroisoquinolin-1-one is O=C1c2ccc(Cl)cc2CCN1C1CCOCC1.
What is the InChIKey of 6-chloro-2-(oxan-4-yl)-3,4-dihydroisoquinolin-1-one?
The InChIKey is WVIZOTOMTPOGLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16ClNO2/c15-11-1-2-13-10(9-11)3-6-16(14(13)17)12-4-7-18-8-5-12/h1-2,9,12H,3-8H2.
What are the key properties of 6-chloro-2-(oxan-4-yl)-3,4-dihydroisoquinolin-1-one?
6-chloro-2-(oxan-4-yl)-3,4-dihydroisoquinolin-1-one has a molecular weight of 265.74 g/mol, XLogP of 2.52, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2-(oxan-4-yl)-3,4-dihydroisoquinolin-1-one is sourced from PubChem (CID 67468989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).