About sodium;1-bromo-2-chloro-5-fluoro-4-nitrobenzene;methanolate
sodium;1-bromo-2-chloro-5-fluoro-4-nitrobenzene;methanolate (PubChem CID 67469276) has the molecular formula C7H5BrClFNNaO3
and a molecular weight of 308.47 g/mol. Its IUPAC name is sodium;1-bromo-2-chloro-5-fluoro-4-nitrobenzene;methanolate.
Molecular Properties
| Compound Name | sodium;1-bromo-2-chloro-5-fluoro-4-nitrobenzene;methanolate |
| PubChem CID | 67469276 |
| Molecular Formula | C7H5BrClFNNaO3 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 306.90 |
| IUPAC Name | sodium;1-bromo-2-chloro-5-fluoro-4-nitrobenzene;methanolate |
| SMILES | C[O-].O=[N+]([O-])c1cc(Cl)c(Br)cc1F.[Na+] |
| InChI | InChI=1S/C6H2BrClFNO2.CH3O.Na/c7-3-1-5(9)6(10(11)12)2-4(3)8;1-2;/h1-2H;1H3;/q;-1;+1 |
| InChIKey | HLBFVEALEFCVMB-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 66.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze sodium;1-bromo-2-chloro-5-fluoro-4-nitrobenzene;methanolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;1-bromo-2-chloro-5-fluoro-4-nitrobenzene;methanolate?
The IUPAC name of sodium;1-bromo-2-chloro-5-fluoro-4-nitrobenzene;methanolate (CID 67469276) is sodium;1-bromo-2-chloro-5-fluoro-4-nitrobenzene;methanolate.
What is the SMILES notation for sodium;1-bromo-2-chloro-5-fluoro-4-nitrobenzene;methanolate?
The canonical SMILES for sodium;1-bromo-2-chloro-5-fluoro-4-nitrobenzene;methanolate is C[O-].O=[N+]([O-])c1cc(Cl)c(Br)cc1F.[Na+].
What is the InChIKey of sodium;1-bromo-2-chloro-5-fluoro-4-nitrobenzene;methanolate?
The InChIKey is HLBFVEALEFCVMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H2BrClFNO2.CH3O.Na/c7-3-1-5(9)6(10(11)12)2-4(3)8;1-2;/h1-2H;1H3;/q;-1;+1.
What are the key properties of sodium;1-bromo-2-chloro-5-fluoro-4-nitrobenzene;methanolate?
sodium;1-bromo-2-chloro-5-fluoro-4-nitrobenzene;methanolate has a molecular weight of 308.47 g/mol, XLogP of -0.87, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;1-bromo-2-chloro-5-fluoro-4-nitrobenzene;methanolate is sourced from PubChem (CID 67469276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).