C24H25N3O2S — CID 67469516
3-[2-(3,5-dihydroxyhexan-2-yl)phenyl]-4-naphthalen-1-yl-1H-1,2,4-triazole-5-thione (PubChem CID 67469516) has the molecular formula C24H25N3O2S and a molecular weight of 419.55 g/mol. Its IUPAC name is 3-[2-(3,5-dihydroxyhexan-2-yl)phenyl]-4-naphthalen-1-yl-1H-1,2,4-triazole-5-thione.
| Compound Name | 3-[2-(3,5-dihydroxyhexan-2-yl)phenyl]-4-naphthalen-1-yl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 67469516 |
| Molecular Formula | C24H25N3O2S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | 3-[2-(3,5-dihydroxyhexan-2-yl)phenyl]-4-naphthalen-1-yl-1H-1,2,4-triazole-5-thione |
| SMILES | CC(O)CC(O)C(C)c1ccccc1-c1n[nH]c(=S)n1-c1cccc2ccccc12 |
| InChI | InChI=1S/C24H25N3O2S/c1-15(28)14-22(29)16(2)18-10-5-6-12-20(18)23-25-26-24(30)27(23)21-13-7-9-17-8-3-4-11-19(17)21/h3-13,15-16,22,28-29H,14H2,1-2H3,(H,26,30) |
| InChIKey | MVAPVCGBZIUBRO-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 74.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|