C23H25F2N5OSi — CID 67469565
N-[2-(2,5-difluorophenyl)-4-pyridinyl]-2-(2-trimethylsilylethoxymethyl)pyrazolo[4,3-b]pyridin-7-amine (PubChem CID 67469565) has the molecular formula C23H25F2N5OSi and a molecular weight of 453.57 g/mol. Its IUPAC name is N-[2-(2,5-difluorophenyl)-4-pyridinyl]-2-(2-trimethylsilylethoxymethyl)pyrazolo[4,3-b]pyridin-7-amine.
| Compound Name | N-[2-(2,5-difluorophenyl)-4-pyridinyl]-2-(2-trimethylsilylethoxymethyl)pyrazolo[4,3-b]pyridin-7-amine |
|---|---|
| PubChem CID | 67469565 |
| Molecular Formula | C23H25F2N5OSi |
| Molecular Weight | 453.57 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | N-[2-(2,5-difluorophenyl)-4-pyridinyl]-2-(2-trimethylsilylethoxymethyl)pyrazolo[4,3-b]pyridin-7-amine |
| SMILES | C[Si](C)(C)CCOCn1cc2nccc(Nc3ccnc(-c4cc(F)ccc4F)c3)c2n1 |
| InChI | InChI=1S/C23H25F2N5OSi/c1-32(2,3)11-10-31-15-30-14-22-23(29-30)20(7-9-27-22)28-17-6-8-26-21(13-17)18-12-16(24)4-5-19(18)25/h4-9,12-14H,10-11,15H2,1-3H3,(H,26,28) |
| InChIKey | KZKRDAHGGUCJOS-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.57 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|