About CID 67469645
CID 67469645 (PubChem CID 67469645) has the molecular formula C9H8NO2Si
and a molecular weight of 190.25 g/mol.
Molecular Properties
| Compound Name | CID 67469645 |
| PubChem CID | 67469645 |
| Molecular Formula | C9H8NO2Si |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.03 |
| IUPAC Name | — |
| SMILES | COC1=NOc2ccccc2C1[Si] |
| InChI | InChI=1S/C9H8NO2Si/c1-11-9-8(13)6-4-2-3-5-7(6)12-10-9/h2-5,8H,1H3 |
| InChIKey | BRADIIUHSIYVOG-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 67469645 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 67469645?
The IUPAC name of CID 67469645 (CID 67469645) is not available.
What is the SMILES notation for CID 67469645?
The canonical SMILES for CID 67469645 is COC1=NOc2ccccc2C1[Si].
What is the InChIKey of CID 67469645?
The InChIKey is BRADIIUHSIYVOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8NO2Si/c1-11-9-8(13)6-4-2-3-5-7(6)12-10-9/h2-5,8H,1H3.
What are the key properties of CID 67469645?
CID 67469645 has a molecular weight of 190.25 g/mol, XLogP of 1.25, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 67469645 is sourced from PubChem (CID 67469645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).