C18H15NO4S2 — CID 67470058
4-[5-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl]aniline (PubChem CID 67470058) has the molecular formula C18H15NO4S2 and a molecular weight of 373.46 g/mol. Its IUPAC name is 4-[5-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl]aniline.
| Compound Name | 4-[5-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl]aniline |
|---|---|
| PubChem CID | 67470058 |
| Molecular Formula | C18H15NO4S2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | 4-[5-(2,3-dihydrothieno[3,4-b][1,4]dioxin-5-yl)-2,3-dihydrothieno[3,4-b][1,4]dioxin-7-yl]aniline |
| SMILES | Nc1ccc(-c2sc(-c3scc4c3OCCO4)c3c2OCCO3)cc1 |
| InChI | InChI=1S/C18H15NO4S2/c19-11-3-1-10(2-4-11)16-14-15(23-8-7-22-14)18(25-16)17-13-12(9-24-17)20-5-6-21-13/h1-4,9H,5-8,19H2 |
| InChIKey | MENUNIFYPZQYPP-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|