About (2S)-2-[(2-aminoacetyl)amino]-4-methylpentanoic acid;1-methyl-2H-pyridine-3-carboxamide
(2S)-2-[(2-aminoacetyl)amino]-4-methylpentanoic acid;1-methyl-2H-pyridine-3-carboxamide (PubChem CID 67470229) has the molecular formula C15H26N4O4
and a molecular weight of 326.40 g/mol. Its IUPAC name is (2S)-2-[(2-aminoacetyl)amino]-4-methylpentanoic acid;1-methyl-2H-pyridine-3-carboxamide.
Molecular Properties
| Compound Name | (2S)-2-[(2-aminoacetyl)amino]-4-methylpentanoic acid;1-methyl-2H-pyridine-3-carboxamide |
| PubChem CID | 67470229 |
| Molecular Formula | C15H26N4O4 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.20 |
| IUPAC Name | (2S)-2-[(2-aminoacetyl)amino]-4-methylpentanoic acid;1-methyl-2H-pyridine-3-carboxamide |
| SMILES | CC(C)C[C@H](NC(=O)CN)C(=O)O.CN1C=CC=C(C(N)=O)C1 |
| InChI | InChI=1S/C8H16N2O3.C7H10N2O/c1-5(2)3-6(8(12)13)10-7(11)4-9;1-9-4-2-3-6(5-9)7(8)10/h5-6H,3-4,9H2,1-2H3,(H,10,11)(H,12,13);2-4H,5H2,1H3,(H2,8,10)/t6-;/m0./s1 |
| InChIKey | ASYBUUZBKZHULL-RGMNGODLSA-N |
| XLogP | -0.58 |
| TPSA | 138.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (2S)-2-[(2-aminoacetyl)amino]-4-methylpentanoic acid;1-methyl-2H-pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-[(2-aminoacetyl)amino]-4-methylpentanoic acid;1-methyl-2H-pyridine-3-carboxamide?
The IUPAC name of (2S)-2-[(2-aminoacetyl)amino]-4-methylpentanoic acid;1-methyl-2H-pyridine-3-carboxamide (CID 67470229) is (2S)-2-[(2-aminoacetyl)amino]-4-methylpentanoic acid;1-methyl-2H-pyridine-3-carboxamide.
What is the SMILES notation for (2S)-2-[(2-aminoacetyl)amino]-4-methylpentanoic acid;1-methyl-2H-pyridine-3-carboxamide?
The canonical SMILES for (2S)-2-[(2-aminoacetyl)amino]-4-methylpentanoic acid;1-methyl-2H-pyridine-3-carboxamide is CC(C)C[C@H](NC(=O)CN)C(=O)O.CN1C=CC=C(C(N)=O)C1.
What is the InChIKey of (2S)-2-[(2-aminoacetyl)amino]-4-methylpentanoic acid;1-methyl-2H-pyridine-3-carboxamide?
The InChIKey is ASYBUUZBKZHULL-RGMNGODLSA-N. The full InChI is InChI=1S/C8H16N2O3.C7H10N2O/c1-5(2)3-6(8(12)13)10-7(11)4-9;1-9-4-2-3-6(5-9)7(8)10/h5-6H,3-4,9H2,1-2H3,(H,10,11)(H,12,13);2-4H,5H2,1H3,(H2,8,10)/t6-;/m0./s1.
What are the key properties of (2S)-2-[(2-aminoacetyl)amino]-4-methylpentanoic acid;1-methyl-2H-pyridine-3-carboxamide?
(2S)-2-[(2-aminoacetyl)amino]-4-methylpentanoic acid;1-methyl-2H-pyridine-3-carboxamide has a molecular weight of 326.40 g/mol, XLogP of -0.58, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-[(2-aminoacetyl)amino]-4-methylpentanoic acid;1-methyl-2H-pyridine-3-carboxamide is sourced from PubChem (CID 67470229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).