C31H28ClFN8O5 — CID 67470606
N-[amino-[4-[[[5-(chloromethoxy)-1-pyrimidin-2-yl-1,2,4-triazol-3-yl]-[2-fluoro-3-(2-hydroxyethoxy)-5-methoxyphenyl]methyl]amino]phenyl]methylidene]benzamide (PubChem CID 67470606) has the molecular formula C31H28ClFN8O5 and a molecular weight of 647.07 g/mol. Its IUPAC name is N-[amino-[4-[[[5-(chloromethoxy)-1-pyrimidin-2-yl-1,2,4-triazol-3-yl]-[2-fluoro-3-(2-hydroxyethoxy)-5-methoxyphenyl]methyl]amino]phenyl]methylidene]benzamide.
| Compound Name | N-[amino-[4-[[[5-(chloromethoxy)-1-pyrimidin-2-yl-1,2,4-triazol-3-yl]-[2-fluoro-3-(2-hydroxyethoxy)-5-methoxyphenyl]methyl]amino]phenyl]methylidene]benzamide |
|---|---|
| PubChem CID | 67470606 |
| Molecular Formula | C31H28ClFN8O5 |
| Molecular Weight | 647.07 g/mol |
| Exact Mass | 646.19 |
| IUPAC Name | N-[amino-[4-[[[5-(chloromethoxy)-1-pyrimidin-2-yl-1,2,4-triazol-3-yl]-[2-fluoro-3-(2-hydroxyethoxy)-5-methoxyphenyl]methyl]amino]phenyl]methylidene]benzamide |
| SMILES | COc1cc(OCCO)c(F)c(C(Nc2ccc(/C(N)=N/C(=O)c3ccccc3)cc2)c2nc(OCCl)n(-c3ncccn3)n2)c1 |
| InChI | InChI=1S/C31H28ClFN8O5/c1-44-22-16-23(25(33)24(17-22)45-15-14-42)26(28-39-31(46-18-32)41(40-28)30-35-12-5-13-36-30)37-21-10-8-19(9-11-21)27(34)38-29(43)20-6-3-2-4-7-20/h2-13,16-17,26,37,42H,14-15,18H2,1H3,(H2,34,38,43) |
| InChIKey | WKSVFJVANKDNHV-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 171.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.07 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|