About 6-benzyl-2-N,5-bis(1H-indol-5-ylmethyl)pyrimidine-2,4-diamine
6-benzyl-2-N,5-bis(1H-indol-5-ylmethyl)pyrimidine-2,4-diamine (PubChem CID 67470649) has the molecular formula C29H26N6
and a molecular weight of 458.57 g/mol. Its IUPAC name is 6-benzyl-2-N,5-bis(1H-indol-5-ylmethyl)pyrimidine-2,4-diamine.
Molecular Properties
| Compound Name | 6-benzyl-2-N,5-bis(1H-indol-5-ylmethyl)pyrimidine-2,4-diamine |
| PubChem CID | 67470649 |
| Molecular Formula | C29H26N6 |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | 6-benzyl-2-N,5-bis(1H-indol-5-ylmethyl)pyrimidine-2,4-diamine |
| SMILES | Nc1nc(NCc2ccc3[nH]ccc3c2)nc(Cc2ccccc2)c1Cc1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/C29H26N6/c30-28-24(16-20-6-8-25-22(14-20)10-12-31-25)27(17-19-4-2-1-3-5-19)34-29(35-28)33-18-21-7-9-26-23(15-21)11-13-32-26/h1-15,31-32H,16-18H2,(H3,30,33,34,35) |
| InChIKey | RJSLBUNRTJBFBP-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-benzyl-2-N,5-bis(1H-indol-5-ylmethyl)pyrimidine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-benzyl-2-N,5-bis(1H-indol-5-ylmethyl)pyrimidine-2,4-diamine?
The IUPAC name of 6-benzyl-2-N,5-bis(1H-indol-5-ylmethyl)pyrimidine-2,4-diamine (CID 67470649) is 6-benzyl-2-N,5-bis(1H-indol-5-ylmethyl)pyrimidine-2,4-diamine.
What is the SMILES notation for 6-benzyl-2-N,5-bis(1H-indol-5-ylmethyl)pyrimidine-2,4-diamine?
The canonical SMILES for 6-benzyl-2-N,5-bis(1H-indol-5-ylmethyl)pyrimidine-2,4-diamine is Nc1nc(NCc2ccc3[nH]ccc3c2)nc(Cc2ccccc2)c1Cc1ccc2[nH]ccc2c1.
What is the InChIKey of 6-benzyl-2-N,5-bis(1H-indol-5-ylmethyl)pyrimidine-2,4-diamine?
The InChIKey is RJSLBUNRTJBFBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H26N6/c30-28-24(16-20-6-8-25-22(14-20)10-12-31-25)27(17-19-4-2-1-3-5-19)34-29(35-28)33-18-21-7-9-26-23(15-21)11-13-32-26/h1-15,31-32H,16-18H2,(H3,30,33,34,35).
What are the key properties of 6-benzyl-2-N,5-bis(1H-indol-5-ylmethyl)pyrimidine-2,4-diamine?
6-benzyl-2-N,5-bis(1H-indol-5-ylmethyl)pyrimidine-2,4-diamine has a molecular weight of 458.57 g/mol, XLogP of 5.82, 7 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-benzyl-2-N,5-bis(1H-indol-5-ylmethyl)pyrimidine-2,4-diamine is sourced from PubChem (CID 67470649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).