C19H21NO3S — CID 67470797
1-(3-methylsulfonylphenyl)-2,3,3a,4,5,10b-hexahydro-1H-[1]benzoxepino[4,5-c]pyrrole (PubChem CID 67470797) has the molecular formula C19H21NO3S and a molecular weight of 343.45 g/mol. Its IUPAC name is 1-(3-methylsulfonylphenyl)-2,3,3a,4,5,10b-hexahydro-1H-[1]benzoxepino[4,5-c]pyrrole.
| Compound Name | 1-(3-methylsulfonylphenyl)-2,3,3a,4,5,10b-hexahydro-1H-[1]benzoxepino[4,5-c]pyrrole |
|---|---|
| PubChem CID | 67470797 |
| Molecular Formula | C19H21NO3S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | 1-(3-methylsulfonylphenyl)-2,3,3a,4,5,10b-hexahydro-1H-[1]benzoxepino[4,5-c]pyrrole |
| SMILES | CS(=O)(=O)c1cccc(C2NCC3CCOc4ccccc4C32)c1 |
| InChI | InChI=1S/C19H21NO3S/c1-24(21,22)15-6-4-5-13(11-15)19-18-14(12-20-19)9-10-23-17-8-3-2-7-16(17)18/h2-8,11,14,18-20H,9-10,12H2,1H3 |
| InChIKey | FLULRMWMENYMPX-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |