C12H14N2O — CID 67470963
(3aS)-2,3,3a,5,6,10b-hexahydro-1H-pyrrolo[3,4-d][2]benzazepin-4-one (PubChem CID 67470963) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is (3aS)-2,3,3a,5,6,10b-hexahydro-1H-pyrrolo[3,4-d][2]benzazepin-4-one.
| Compound Name | (3aS)-2,3,3a,5,6,10b-hexahydro-1H-pyrrolo[3,4-d][2]benzazepin-4-one |
|---|---|
| PubChem CID | 67470963 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | (3aS)-2,3,3a,5,6,10b-hexahydro-1H-pyrrolo[3,4-d][2]benzazepin-4-one |
| SMILES | O=C1NCc2ccccc2C2CNC[C@@H]12 |
| InChI | InChI=1S/C12H14N2O/c15-12-11-7-13-6-10(11)9-4-2-1-3-8(9)5-14-12/h1-4,10-11,13H,5-7H2,(H,14,15)/t10?,11-/m1/s1 |
| InChIKey | XEEZHFXVAVHHRI-RRKGBCIJSA-N |
| XLogP | 0.62 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |