C20H22ClFN6O2 — CID 67471097
N-(4-chlorobutyl)-5-[2-(5-fluoro-2-oxo-1H-pyridin-3-yl)pyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 67471097) has the molecular formula C20H22ClFN6O2 and a molecular weight of 432.89 g/mol. Its IUPAC name is N-(4-chlorobutyl)-5-[2-(5-fluoro-2-oxo-1H-pyridin-3-yl)pyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | N-(4-chlorobutyl)-5-[2-(5-fluoro-2-oxo-1H-pyridin-3-yl)pyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 67471097 |
| Molecular Formula | C20H22ClFN6O2 |
| Molecular Weight | 432.89 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | N-(4-chlorobutyl)-5-[2-(5-fluoro-2-oxo-1H-pyridin-3-yl)pyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | O=C(NCCCCCl)c1cnn2ccc(N3CCCC3c3cc(F)c[nH]c3=O)nc12 |
| InChI | InChI=1S/C20H22ClFN6O2/c21-6-1-2-7-23-20(30)15-12-25-28-9-5-17(26-18(15)28)27-8-3-4-16(27)14-10-13(22)11-24-19(14)29/h5,9-12,16H,1-4,6-8H2,(H,23,30)(H,24,29) |
| InChIKey | LDLBXGJRHPFECW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 95.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.89 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|