About 2H-pyrimidin-1-ylmethyl N-cyclohexylcarbamate
2H-pyrimidin-1-ylmethyl N-cyclohexylcarbamate (PubChem CID 67471183) has the molecular formula C12H19N3O2
and a molecular weight of 237.30 g/mol. Its IUPAC name is 2H-pyrimidin-1-ylmethyl N-cyclohexylcarbamate.
Molecular Properties
| Compound Name | 2H-pyrimidin-1-ylmethyl N-cyclohexylcarbamate |
| PubChem CID | 67471183 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 2H-pyrimidin-1-ylmethyl N-cyclohexylcarbamate |
| SMILES | O=C(NC1CCCCC1)OCN1C=CC=NC1 |
| InChI | InChI=1S/C12H19N3O2/c16-12(14-11-5-2-1-3-6-11)17-10-15-8-4-7-13-9-15/h4,7-8,11H,1-3,5-6,9-10H2,(H,14,16) |
| InChIKey | INZFPTPGXAZUSL-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 53.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2H-pyrimidin-1-ylmethyl N-cyclohexylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-pyrimidin-1-ylmethyl N-cyclohexylcarbamate?
The IUPAC name of 2H-pyrimidin-1-ylmethyl N-cyclohexylcarbamate (CID 67471183) is 2H-pyrimidin-1-ylmethyl N-cyclohexylcarbamate.
What is the SMILES notation for 2H-pyrimidin-1-ylmethyl N-cyclohexylcarbamate?
The canonical SMILES for 2H-pyrimidin-1-ylmethyl N-cyclohexylcarbamate is O=C(NC1CCCCC1)OCN1C=CC=NC1.
What is the InChIKey of 2H-pyrimidin-1-ylmethyl N-cyclohexylcarbamate?
The InChIKey is INZFPTPGXAZUSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O2/c16-12(14-11-5-2-1-3-6-11)17-10-15-8-4-7-13-9-15/h4,7-8,11H,1-3,5-6,9-10H2,(H,14,16).
What are the key properties of 2H-pyrimidin-1-ylmethyl N-cyclohexylcarbamate?
2H-pyrimidin-1-ylmethyl N-cyclohexylcarbamate has a molecular weight of 237.30 g/mol, XLogP of 1.86, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-pyrimidin-1-ylmethyl N-cyclohexylcarbamate is sourced from PubChem (CID 67471183), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).