About CID 67472598
CID 67472598 (PubChem CID 67472598) has the molecular formula C8H12BO2
and a molecular weight of 150.99 g/mol.
Molecular Properties
| Compound Name | CID 67472598 |
| PubChem CID | 67472598 |
| Molecular Formula | C8H12BO2 |
| Molecular Weight | 150.99 g/mol |
| Exact Mass | 151.09 |
| IUPAC Name | — |
| SMILES | CC1[B]C(C)C2C(=O)OCC12 |
| InChI | InChI=1S/C8H12BO2/c1-4-6-3-11-8(10)7(6)5(2)9-4/h4-7H,3H2,1-2H3 |
| InChIKey | OTERHEQPGZJDAI-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.99 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 67472598 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 67472598?
The IUPAC name of CID 67472598 (CID 67472598) is not available.
What is the SMILES notation for CID 67472598?
The canonical SMILES for CID 67472598 is CC1[B]C(C)C2C(=O)OCC12.
What is the InChIKey of CID 67472598?
The InChIKey is OTERHEQPGZJDAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12BO2/c1-4-6-3-11-8(10)7(6)5(2)9-4/h4-7H,3H2,1-2H3.
What are the key properties of CID 67472598?
CID 67472598 has a molecular weight of 150.99 g/mol, XLogP of 1.11, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 67472598 is sourced from PubChem (CID 67472598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).