C19H27Br — CID 67472797
6-bromo-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydro-1H-phenanthrene (PubChem CID 67472797) has the molecular formula C19H27Br and a molecular weight of 335.33 g/mol. Its IUPAC name is 6-bromo-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydro-1H-phenanthrene.
| Compound Name | 6-bromo-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydro-1H-phenanthrene |
|---|---|
| PubChem CID | 67472797 |
| Molecular Formula | C19H27Br |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 6-bromo-1,4a-dimethyl-7-propan-2-yl-2,3,4,9,10,10a-hexahydro-1H-phenanthrene |
| SMILES | CC(C)c1cc2c(cc1Br)C1(C)CCCC(C)C1CC2 |
| InChI | InChI=1S/C19H27Br/c1-12(2)15-10-14-7-8-16-13(3)6-5-9-19(16,4)17(14)11-18(15)20/h10-13,16H,5-9H2,1-4H3 |
| InChIKey | RPHOULYWEQWHMC-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |